| General Information | |
|---|---|
| ZINC ID | ZINC000049767181 |
| Molecular Weight (Da) | 540 |
| SMILES | O=C(NC1CCCCC1)c1nn(-c2ccccc2Cl)c(-c2ccc(Br)cc2)c1Cn1cncn1 |
| Molecular Formula | C25Br1Cl1N6O1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 140.297 |
| HBA | 4 |
| HBD | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| LogP | 5.305 |
| Activity (Ki) in nM | 4073.803 |
| Polar Surface Area (PSA) | 77.63 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.193 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 22 |
| Fraction csp3 | 0.28 |
| Ilogp | 4.16 |
| Xlogp3 | 5.97 |
| Wlogp | 5.66 |
| Mlogp | 4.34 |
| Silicos-it log p | 4.33 |
| Consensus log p | 4.89 |
| Esol log s | -6.97 |
| Esol solubility (mg/ml) | 0.0000585 |
| Esol solubility (mol/l) | 0.0000001 |
| Esol class | Poorly sol |
| Ali log s | -7.38 |
| Ali solubility (mg/ml) | 0.0000227 |
| Ali solubility (mol/l) | 0.00000004 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.69 |
| Silicos-it solubility (mg/ml) | 0.00000111 |
| Silicos-it solubility (mol/l) | 2.06E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.35 |
| Lipinski number of violations | 2 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.17 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.64 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.748 |
| Logd | 4.453 |
| Logp | 5.305 |
| F (20%) | 0.001 |
| F (30%) | 0.002 |
| Mdck | 2.53E-05 |
| Ppb | 0.9738 |
| Vdss | 2.199 |
| Fu | 0.0241 |
| Cyp1a2-inh | 0.397 |
| Cyp1a2-sub | 0.104 |
| Cyp2c19-inh | 0.901 |
| Cyp2c19-sub | 0.093 |
| Cl | 4.962 |
| T12 | 0.047 |
| H-ht | 0.381 |
| Dili | 0.987 |
| Roa | 0.919 |
| Fdamdd | 0.548 |
| Skinsen | 0.525 |
| Ec | 0.003 |
| Ei | 0.01 |
| Respiratory | 0.656 |
| Bcf | 1.503 |
| Igc50 | 4.681 |
| Lc50 | 6.059 |
| Lc50dm | 4.394 |
| Nr-ar | 0.005 |
| Nr-ar-lbd | 0.008 |
| Nr-ahr | 0.913 |
| Nr-aromatase | 0.99 |
| Nr-er | 0.586 |
| Nr-er-lbd | 0.027 |
| Nr-ppar-gamma | 0.879 |
| Sr-are | 0.879 |
| Sr-atad5 | 0.156 |
| Sr-hse | 0.661 |
| Sr-mmp | 0.864 |
| Sr-p53 | 0.833 |
| Vol | 478.438 |
| Dense | 1.125 |
| Flex | 0.241 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 2 |
| Qed | 0.343 |
| Synth | 2.592 |
| Fsp3 | 0.28 |
| Mce-18 | 61.75 |
| Natural product-likeness | -1.653 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Rejected |