| General Information | |
|---|---|
| ZINC ID | ZINC000049767191 |
| Molecular Weight (Da) | 559 |
| SMILES | CCN1CCC[C@@H]1CNC(=O)c1nn(-c2ccc(Cl)cc2Cl)c(-c2ccc(Cl)cc2)c1Cn1cncn1 |
| Molecular Formula | C26Cl3N7O1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 151.248 |
| HBA | 4 |
| HBD | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| LogP | 5.005 |
| Activity (Ki) in nM | 3981.07 |
| Polar Surface Area (PSA) | 80.87 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | + |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | + |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.87050133 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 22 |
| Fraction csp3 | 0.31 |
| Ilogp | 4.35 |
| Xlogp3 | 5.68 |
| Wlogp | 4.97 |
| Mlogp | 4.11 |
| Silicos-it log p | 4.49 |
| Consensus log p | 4.72 |
| Esol log s | -6.73 |
| Esol solubility (mg/ml) | 0.000104 |
| Esol solubility (mol/l) | 0.00000018 |
| Esol class | Poorly sol |
| Ali log s | -7.14 |
| Ali solubility (mg/ml) | 0.0000402 |
| Ali solubility (mol/l) | 7.18E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.02 |
| Silicos-it solubility (mg/ml) | 0.00000053 |
| Silicos-it solubility (mol/l) | 9.62E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.68 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 2 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 4.29 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.038 |
| Logd | 4.356 |
| Logp | 4.717 |
| F (20%) | 0.001 |
| F (30%) | 0.005 |
| Mdck | - |
| Ppb | 95.00% |
| Vdss | 2.296 |
| Fu | 3.60% |
| Cyp1a2-inh | 0.366 |
| Cyp1a2-sub | 0.688 |
| Cyp2c19-inh | 0.906 |
| Cyp2c19-sub | 0.534 |
| Cl | 8.513 |
| T12 | 0.075 |
| H-ht | 0.615 |
| Dili | 0.979 |
| Roa | 0.167 |
| Fdamdd | 0.49 |
| Skinsen | 0.44 |
| Ec | 0.003 |
| Ei | 0.006 |
| Respiratory | 0.442 |
| Bcf | 1.921 |
| Igc50 | 4.522 |
| Lc50 | 6.185 |
| Lc50dm | 3.764 |
| Nr-ar | 0.004 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.921 |
| Nr-aromatase | 0.959 |
| Nr-er | 0.143 |
| Nr-er-lbd | 0.004 |
| Nr-ppar-gamma | 0.023 |
| Sr-are | 0.742 |
| Sr-atad5 | 0.008 |
| Sr-hse | 0.046 |
| Sr-mmp | 0.47 |
| Sr-p53 | 0.657 |
| Vol | 517.869 |
| Dense | 1.076 |
| Flex | 0.321 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 2 |
| Qed | 0.315 |
| Synth | 3.214 |
| Fsp3 | 0.308 |
| Mce-18 | 90.588 |
| Natural product-likeness | -1.681 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |