| General Information | |
|---|---|
| ZINC ID | ZINC000049775457 |
| Molecular Weight (Da) | 555 |
| SMILES | CN/C(=NS(=O)(=O)c1ccc(C(F)(F)F)cc1)C1=NN(c2ccc(Cl)cc2Cl)[C@H](c2ccccc2)C1 |
| Molecular Formula | C24Cl2F3N4O2S1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 134.135 |
| HBA | 4 |
| HBD | 0 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| LogP | 6.582 |
| Activity (Ki) in nM | 2.5119 |
| Polar Surface Area (PSA) | 82.51 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.14 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 18 |
| Fraction csp3 | 0.17 |
| Ilogp | 3.93 |
| Xlogp3 | 6.3 |
| Wlogp | 7.47 |
| Mlogp | 5.34 |
| Silicos-it log p | 5.67 |
| Consensus log p | 5.74 |
| Esol log s | -7.16 |
| Esol solubility (mg/ml) | 0.0000384 |
| Esol solubility (mol/l) | 6.91E-08 |
| Esol class | Poorly sol |
| Ali log s | -7.82 |
| Ali solubility (mg/ml) | 0.00000838 |
| Ali solubility (mol/l) | 1.51E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.73 |
| Silicos-it solubility (mg/ml) | 0.0000001 |
| Silicos-it solubility (mol/l) | 1.85E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.21 |
| Lipinski number of violations | 2 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.17 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 2 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 4.47 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.401 |
| Logd | 2.515 |
| Logp | 5.286 |
| F (20%) | 0.001 |
| F (30%) | 0.001 |
| Mdck | - |
| Ppb | 98.92% |
| Vdss | 1.184 |
| Fu | 2.16% |
| Cyp1a2-inh | 0.421 |
| Cyp1a2-sub | 0.749 |
| Cyp2c19-inh | 0.943 |
| Cyp2c19-sub | 0.931 |
| Cl | 0.524 |
| T12 | 0.009 |
| H-ht | 0.95 |
| Dili | 0.992 |
| Roa | 0.665 |
| Fdamdd | 0.966 |
| Skinsen | 0.029 |
| Ec | 0.003 |
| Ei | 0.007 |
| Respiratory | 0.945 |
| Bcf | 1.66 |
| Igc50 | 5.001 |
| Lc50 | 5.708 |
| Lc50dm | 5.51 |
| Nr-ar | 0.009 |
| Nr-ar-lbd | 0.325 |
| Nr-ahr | 0.144 |
| Nr-aromatase | 0.172 |
| Nr-er | 0.353 |
| Nr-er-lbd | 0.012 |
| Nr-ppar-gamma | 0.468 |
| Sr-are | 0.779 |
| Sr-atad5 | 0.005 |
| Sr-hse | 0.009 |
| Sr-mmp | 0.931 |
| Sr-p53 | 0.691 |
| Vol | 489.135 |
| Dense | 1.133 |
| Flex | 0.269 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | - |
| Toxicophores | 2 |
| Qed | 0.296 |
| Synth | 3.206 |
| Fsp3 | 0.167 |
| Mce-18 | 88 |
| Natural product-likeness | -1.391 |
| Alarm nmr | 2 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |