| General Information | |
|---|---|
| ZINC ID | ZINC000049777082 |
| Molecular Weight (Da) | 534 |
| SMILES | CC(C)(CO)NC(=O)[C@@H]1CC(C)(C)Oc2nc(-c3ccc(Cl)cc3Cl)c(-c3ccc(Cl)cc3)cc21 |
| Molecular Formula | C27Cl3N2O3 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 140.266 |
| HBA | 4 |
| HBD | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| LogP | 6.583 |
| Activity (Ki) in nM | 5128.614 |
| Polar Surface Area (PSA) | 71.45 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.661 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 18 |
| Fraction csp3 | 0.33 |
| Ilogp | 4.1 |
| Xlogp3 | 6.26 |
| Wlogp | 6.91 |
| Mlogp | 4.55 |
| Silicos-it log p | 7.25 |
| Consensus log p | 5.81 |
| Esol log s | -7.08 |
| Esol solubility (mg/ml) | 0.0000446 |
| Esol solubility (mol/l) | 8.35E-08 |
| Esol class | Poorly sol |
| Ali log s | -7.55 |
| Ali solubility (mg/ml) | 0.0000151 |
| Ali solubility (mol/l) | 2.83E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -10.45 |
| Silicos-it solubility (mg/ml) | 1.92E-08 |
| Silicos-it solubility (mol/l) | 3.59E-11 |
| Silicos-it class | Insoluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.11 |
| Lipinski number of violations | 2 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.17 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 4.35 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.138 |
| Logd | 4.686 |
| Logp | 6.734 |
| F (20%) | 0.002 |
| F (30%) | 0.002 |
| Mdck | 7.57E-06 |
| Ppb | 1.0134 |
| Vdss | 1.185 |
| Fu | 0.0078 |
| Cyp1a2-inh | 0.212 |
| Cyp1a2-sub | 0.896 |
| Cyp2c19-inh | 0.784 |
| Cyp2c19-sub | 0.116 |
| Cl | 3.77 |
| T12 | 0.022 |
| H-ht | 0.94 |
| Dili | 0.949 |
| Roa | 0.756 |
| Fdamdd | 0.896 |
| Skinsen | 0.021 |
| Ec | 0.003 |
| Ei | 0.006 |
| Respiratory | 0.108 |
| Bcf | 3.314 |
| Igc50 | 5.07 |
| Lc50 | 6.97 |
| Lc50dm | 6.226 |
| Nr-ar | 0.016 |
| Nr-ar-lbd | 0.006 |
| Nr-ahr | 0.938 |
| Nr-aromatase | 0.88 |
| Nr-er | 0.49 |
| Nr-er-lbd | 0.376 |
| Nr-ppar-gamma | 0.691 |
| Sr-are | 0.828 |
| Sr-atad5 | 0.014 |
| Sr-hse | 0.784 |
| Sr-mmp | 0.947 |
| Sr-p53 | 0.894 |
| Vol | 508.955 |
| Dense | 1.045 |
| Flex | 0.25 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 3 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 0 |
| Qed | 0.374 |
| Synth | 3.401 |
| Fsp3 | 0.333 |
| Mce-18 | 91.833 |
| Natural product-likeness | -0.301 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Rejected |