| General Information | |
|---|---|
| ZINC ID | ZINC000049785579 |
| Molecular Weight (Da) | 543 |
| SMILES | Cc1nc(C(=O)N[C@@H]2CC(C)(C)Oc3nc(-c4ccc(Cl)cc4Cl)c(-c4ccc(Cl)cc4)cc32)n[nH]1 |
| Molecular Formula | C26Cl3N5O2 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 143.679 |
| HBA | 5 |
| HBD | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| LogP | 5.69 |
| Activity (Ki) in nM | 5248.075 |
| Polar Surface Area (PSA) | 92.79 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.924 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 23 |
| Fraction csp3 | 0.23 |
| Ilogp | 3.68 |
| Xlogp3 | 6.68 |
| Wlogp | 6.51 |
| Mlogp | 4.05 |
| Silicos-it log p | 6.91 |
| Consensus log p | 5.57 |
| Esol log s | -7.56 |
| Esol solubility (mg/ml) | 0.0000151 |
| Esol solubility (mol/l) | 2.77E-08 |
| Esol class | Poorly sol |
| Ali log s | -8.43 |
| Ali solubility (mg/ml) | 0.00000201 |
| Ali solubility (mol/l) | 3.70E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -11.15 |
| Silicos-it solubility (mg/ml) | 3.83E-09 |
| Silicos-it solubility (mol/l) | 7.06E-12 |
| Silicos-it class | Insoluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.87 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 4.23 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.612 |
| Logd | 4.851 |
| Logp | 7.039 |
| F (20%) | 0.002 |
| F (30%) | 0.003 |
| Mdck | 1.00E-05 |
| Ppb | 1.0058 |
| Vdss | 0.44 |
| Fu | 0.012 |
| Cyp1a2-inh | 0.635 |
| Cyp1a2-sub | 0.62 |
| Cyp2c19-inh | 0.926 |
| Cyp2c19-sub | 0.063 |
| Cl | 2.162 |
| T12 | 0.019 |
| H-ht | 0.934 |
| Dili | 0.979 |
| Roa | 0.053 |
| Fdamdd | 0.974 |
| Skinsen | 0.024 |
| Ec | 0.003 |
| Ei | 0.007 |
| Respiratory | 0.557 |
| Bcf | 2.267 |
| Igc50 | 4.642 |
| Lc50 | 6.777 |
| Lc50dm | 5.995 |
| Nr-ar | 0.011 |
| Nr-ar-lbd | 0.017 |
| Nr-ahr | 0.906 |
| Nr-aromatase | 0.926 |
| Nr-er | 0.34 |
| Nr-er-lbd | 0.037 |
| Nr-ppar-gamma | 0.864 |
| Sr-are | 0.874 |
| Sr-atad5 | 0.198 |
| Sr-hse | 0.298 |
| Sr-mmp | 0.886 |
| Sr-p53 | 0.914 |
| Vol | 502.03 |
| Dense | 1.078 |
| Flex | 0.172 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 0 |
| Qed | 0.295 |
| Synth | 3.518 |
| Fsp3 | 0.231 |
| Mce-18 | 98.812 |
| Natural product-likeness | -0.586 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Rejected |