| General Information | |
|---|---|
| ZINC ID | ZINC000049793435 |
| Molecular Weight (Da) | 556 |
| SMILES | Cc1n[nH]c(C)c1C(=O)N[C@@H]1CC(C)(C)Oc2nc(-c3ccc(Cl)cc3Cl)c(-c3ccc(Cl)cc3)cc21 |
| Molecular Formula | C28Cl3N4O2 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 148.668 |
| HBA | 4 |
| HBD | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| LogP | 6.486 |
| Activity (Ki) in nM | 2290.868 |
| Polar Surface Area (PSA) | 79.9 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.847 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 23 |
| Fraction csp3 | 0.25 |
| Ilogp | 3.78 |
| Xlogp3 | 6.98 |
| Wlogp | 7.42 |
| Mlogp | 4.83 |
| Silicos-it log p | 8.01 |
| Consensus log p | 6.21 |
| Esol log s | -7.81 |
| Esol solubility (mg/ml) | 0.00000853 |
| Esol solubility (mol/l) | 1.54E-08 |
| Esol class | Poorly sol |
| Ali log s | -8.47 |
| Ali solubility (mg/ml) | 0.00000187 |
| Ali solubility (mol/l) | 3.37E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -11.89 |
| Silicos-it solubility (mg/ml) | 7.08E-10 |
| Silicos-it solubility (mol/l) | 1.27E-12 |
| Silicos-it class | Insoluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.74 |
| Lipinski number of violations | 2 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.17 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 4.33 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.885 |
| Logd | 5.025 |
| Logp | 7.402 |
| F (20%) | 0.002 |
| F (30%) | 0.028 |
| Mdck | 7.98E-06 |
| Ppb | 1.0178 |
| Vdss | 1.491 |
| Fu | 0.014 |
| Cyp1a2-inh | 0.586 |
| Cyp1a2-sub | 0.866 |
| Cyp2c19-inh | 0.905 |
| Cyp2c19-sub | 0.064 |
| Cl | 2.88 |
| T12 | 0.01 |
| H-ht | 0.969 |
| Dili | 0.982 |
| Roa | 0.063 |
| Fdamdd | 0.977 |
| Skinsen | 0.023 |
| Ec | 0.003 |
| Ei | 0.007 |
| Respiratory | 0.422 |
| Bcf | 2.877 |
| Igc50 | 5.047 |
| Lc50 | 7.133 |
| Lc50dm | 6.021 |
| Nr-ar | 0.028 |
| Nr-ar-lbd | 0.06 |
| Nr-ahr | 0.932 |
| Nr-aromatase | 0.936 |
| Nr-er | 0.293 |
| Nr-er-lbd | 0.418 |
| Nr-ppar-gamma | 0.941 |
| Sr-are | 0.874 |
| Sr-atad5 | 0.075 |
| Sr-hse | 0.55 |
| Sr-mmp | 0.906 |
| Sr-p53 | 0.943 |
| Vol | 525.625 |
| Dense | 1.054 |
| Flex | 0.172 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 0 |
| Qed | 0.27 |
| Synth | 3.354 |
| Fsp3 | 0.25 |
| Mce-18 | 101.486 |
| Natural product-likeness | -0.719 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Rejected |