| General Information | |
|---|---|
| ZINC ID | ZINC000049872244 |
| Molecular Weight (Da) | 534 |
| SMILES | Cc1c(C(=O)NCNC(=O)[C@@H]2CCC[C@@H](C)C2)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(Cl)cc1 |
| Molecular Formula | C26Cl3N4O2 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 140.175 |
| HBA | 3 |
| HBD | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| LogP | 7.202 |
| Activity (Ki) in nM | 102.329 |
| Polar Surface Area (PSA) | 76.02 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.87076914 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 17 |
| Fraction csp3 | 0.35 |
| Ilogp | 4.82 |
| Xlogp3 | 7.16 |
| Wlogp | 6.44 |
| Mlogp | 5 |
| Silicos-it log p | 5.86 |
| Consensus log p | 5.85 |
| Esol log s | -7.49 |
| Esol solubility (mg/ml) | 0.0000172 |
| Esol solubility (mol/l) | 3.22E-08 |
| Esol class | Poorly sol |
| Ali log s | -8.58 |
| Ali solubility (mg/ml) | 0.00000141 |
| Ali solubility (mol/l) | 2.65E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.46 |
| Silicos-it solubility (mg/ml) | 0.00000018 |
| Silicos-it solubility (mol/l) | 3.47E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.47 |
| Lipinski number of violations | 2 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.17 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 1 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 4.46 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.084 |
| Logd | 5.103 |
| Logp | 6.297 |
| F (20%) | 0.001 |
| F (30%) | 0.002 |
| Mdck | - |
| Ppb | 99.52% |
| Vdss | 1.463 |
| Fu | 1.80% |
| Cyp1a2-inh | 0.215 |
| Cyp1a2-sub | 0.714 |
| Cyp2c19-inh | 0.911 |
| Cyp2c19-sub | 0.695 |
| Cl | 8.105 |
| T12 | 0.051 |
| H-ht | 0.446 |
| Dili | 0.901 |
| Roa | 0.232 |
| Fdamdd | 0.878 |
| Skinsen | 0.438 |
| Ec | 0.003 |
| Ei | 0.01 |
| Respiratory | 0.312 |
| Bcf | 2.174 |
| Igc50 | 5.201 |
| Lc50 | 5.915 |
| Lc50dm | 5.699 |
| Nr-ar | 0.003 |
| Nr-ar-lbd | 0.002 |
| Nr-ahr | 0.726 |
| Nr-aromatase | 0.367 |
| Nr-er | 0.342 |
| Nr-er-lbd | 0.003 |
| Nr-ppar-gamma | 0.018 |
| Sr-are | 0.755 |
| Sr-atad5 | 0.032 |
| Sr-hse | 0.043 |
| Sr-mmp | 0.63 |
| Sr-p53 | 0.706 |
| Vol | 504.862 |
| Dense | 1.054 |
| Flex | 0.32 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 1 |
| Nonbiodegradable | 1 |
| Skin sensitization | 2 |
| Acute aquatic toxicity | - |
| Toxicophores | 1 |
| Qed | 0.358 |
| Synth | 3.335 |
| Fsp3 | 0.346 |
| Mce-18 | 83.571 |
| Natural product-likeness | -1.063 |
| Alarm nmr | 0 |
| Bms | 1 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |