| General Information | |
|---|---|
| ZINC ID | ZINC000049877456 |
| Molecular Weight (Da) | 571 |
| SMILES | CC1(c2nnc(-c3nn(-c4ccc(Cl)cc4Cl)c(-c4ccc(Br)cc4)c3Cn3cncn3)o2)CC1 |
| Molecular Formula | C24Br1Cl2N7O1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 142.491 |
| HBA | 6 |
| HBD | 0 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| LogP | 5.638 |
| Activity (Ki) in nM | 407.38 |
| Polar Surface Area (PSA) | 87.45 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.011 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 27 |
| Fraction csp3 | 0.21 |
| Ilogp | 4.04 |
| Xlogp3 | 5.83 |
| Wlogp | 6.29 |
| Mlogp | 4.93 |
| Silicos-it log p | 5.41 |
| Consensus log p | 5.3 |
| Esol log s | -7.23 |
| Esol solubility (mg/ml) | 0.0000337 |
| Esol solubility (mol/l) | 5.89E-08 |
| Esol class | Poorly sol |
| Ali log s | -7.44 |
| Ali solubility (mg/ml) | 0.0000209 |
| Ali solubility (mol/l) | 3.65E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -10.02 |
| Silicos-it solubility (mg/ml) | 5.49E-08 |
| Silicos-it solubility (mol/l) | 9.62E-11 |
| Silicos-it class | Insoluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.65 |
| Lipinski number of violations | 2 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.17 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.93 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.549 |
| Logd | 4.563 |
| Logp | 5.172 |
| F (20%) | 0.001 |
| F (30%) | 0.001 |
| Mdck | 1.88E-05 |
| Ppb | 0.9672 |
| Vdss | 3.151 |
| Fu | 0.0325 |
| Cyp1a2-inh | 0.35 |
| Cyp1a2-sub | 0.144 |
| Cyp2c19-inh | 0.87 |
| Cyp2c19-sub | 0.065 |
| Cl | 4.463 |
| T12 | 0.035 |
| H-ht | 0.351 |
| Dili | 0.992 |
| Roa | 0.66 |
| Fdamdd | 0.28 |
| Skinsen | 0.079 |
| Ec | 0.003 |
| Ei | 0.009 |
| Respiratory | 0.932 |
| Bcf | 2.079 |
| Igc50 | 4.697 |
| Lc50 | 6.261 |
| Lc50dm | 4.505 |
| Nr-ar | 0.002 |
| Nr-ar-lbd | 0.047 |
| Nr-ahr | 0.763 |
| Nr-aromatase | 0.996 |
| Nr-er | 0.717 |
| Nr-er-lbd | 0.437 |
| Nr-ppar-gamma | 0.823 |
| Sr-are | 0.93 |
| Sr-atad5 | 0.161 |
| Sr-hse | 0.255 |
| Sr-mmp | 0.92 |
| Sr-p53 | 0.89 |
| Vol | 476.157 |
| Dense | 1.195 |
| Flex | 0.2 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 2 |
| Qed | 0.236 |
| Synth | 3.04 |
| Fsp3 | 0.208 |
| Mce-18 | 72.828 |
| Natural product-likeness | -1.295 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Rejected |