| General Information | |
|---|---|
| ZINC ID | ZINC000058575387 |
| Molecular Weight (Da) | 493 |
| SMILES | CCCCCn1cc(C(=O)NC23CC4CC(CC(C4)C2)C3)c(=O)c2cc(C#Cc3ccccc3)ccc21 |
| Molecular Formula | C33N2O2 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 138.008 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| LogP | 7.362 |
| Activity (Ki) in nM | 346.737 |
| Polar Surface Area (PSA) | 51.1 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 0.91865766 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 16 |
| Fraction csp3 | 0.45 |
| Ilogp | 4.96 |
| Xlogp3 | 7.67 |
| Wlogp | 6.37 |
| Mlogp | 4.89 |
| Silicos-it log p | 6.97 |
| Consensus log p | 6.17 |
| Esol log s | -7.58 |
| Esol solubility (mg/ml) | 1.28E-05 |
| Esol solubility (mol/l) | 2.60E-08 |
| Esol class | Poorly sol |
| Ali log s | -8.58 |
| Ali solubility (mg/ml) | 1.29E-06 |
| Ali solubility (mol/l) | 2.61E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.28 |
| Silicos-it solubility (mg/ml) | 2.56E-07 |
| Silicos-it solubility (mol/l) | 5.20E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -3.86 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 4 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 1 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 5.87 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.057 |
| Logd | 5.063 |
| Logp | 7.131 |
| F (20%) | 0.007 |
| F (30%) | 0.753 |
| Mdck | 1.71E-05 |
| Ppb | 0.9656 |
| Vdss | 1.531 |
| Fu | 0.0053 |
| Cyp1a2-inh | 0.105 |
| Cyp1a2-sub | 0.145 |
| Cyp2c19-inh | 0.492 |
| Cyp2c19-sub | 0.07 |
| Cl | 2.028 |
| T12 | 0.002 |
| H-ht | 0.592 |
| Dili | 0.764 |
| Roa | 0.062 |
| Fdamdd | 0.74 |
| Skinsen | 0.555 |
| Ec | 0.003 |
| Ei | 0.019 |
| Respiratory | 0.854 |
| Bcf | 2.691 |
| Igc50 | 5.447 |
| Lc50 | 6.429 |
| Lc50dm | 6.358 |
| Nr-ar | 0 |
| Nr-ar-lbd | 0.002 |
| Nr-ahr | 0.872 |
| Nr-aromatase | 0.952 |
| Nr-er | 0.374 |
| Nr-er-lbd | 0.003 |
| Nr-ppar-gamma | 0.023 |
| Sr-are | 0.845 |
| Sr-atad5 | 0.025 |
| Sr-hse | 0.946 |
| Sr-mmp | 0.884 |
| Sr-p53 | 0.939 |
| Vol | 538.558 |
| Dense | 0.914 |
| Flex | 32 |
| Nstereo | 0.219 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 0 |
| Qed | 4 |
| Synth | 0.325 |
| Fsp3 | 3.822 |
| Mce-18 | 0.455 |
| Natural product-likeness | 77.333 |
| Alarm nmr | -0.978 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Rejected |