| General Information | |
|---|---|
| ZINC ID | ZINC000058583509 |
| Molecular Weight (Da) | 390 |
| SMILES | CCCCCC1=NN(C(=O)N[C@@H]2CCCc3ccccc32)C[C@H]1c1ccccc1 |
| Molecular Formula | C25N3O1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 118.02 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| LogP | 6.17 |
| Activity (Ki) in nM | 22.387 |
| Polar Surface Area (PSA) | 44.7 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 1.067 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 12 |
| Fraction csp3 | 0.44 |
| Ilogp | 4.52 |
| Xlogp3 | 5.23 |
| Wlogp | 4.72 |
| Mlogp | 4.68 |
| Silicos-it log p | 5.25 |
| Consensus log p | 4.88 |
| Esol log s | -5.33 |
| Esol solubility (mg/ml) | 0.00183 |
| Esol solubility (mol/l) | 0.0000047 |
| Esol class | Moderately |
| Ali log s | -5.92 |
| Ali solubility (mg/ml) | 0.000471 |
| Ali solubility (mol/l) | 0.00000121 |
| Ali class | Moderately |
| Silicos-it logsw | -7.7 |
| Silicos-it solubility (mg/ml) | 0.00000779 |
| Silicos-it solubility (mol/l) | 0.00000002 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.96 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 4.64 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.325 |
| Logd | 4.886 |
| Logp | 6.468 |
| F (20%) | 0.917 |
| F (30%) | 0.985 |
| Mdck | 2.44E-05 |
| Ppb | 0.9489 |
| Vdss | 1.233 |
| Fu | 0.0503 |
| Cyp1a2-inh | 0.317 |
| Cyp1a2-sub | 0.85 |
| Cyp2c19-inh | 0.922 |
| Cyp2c19-sub | 0.762 |
| Cl | 2.014 |
| T12 | 0.068 |
| H-ht | 0.841 |
| Dili | 0.962 |
| Roa | 0.655 |
| Fdamdd | 0.853 |
| Skinsen | 0.15 |
| Ec | 0.003 |
| Ei | 0.008 |
| Respiratory | 0.903 |
| Bcf | 1.04 |
| Igc50 | 4.918 |
| Lc50 | 6.463 |
| Lc50dm | 4.756 |
| Nr-ar | 0.068 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.846 |
| Nr-aromatase | 0.473 |
| Nr-er | 0.652 |
| Nr-er-lbd | 0.057 |
| Nr-ppar-gamma | 0.965 |
| Sr-are | 0.232 |
| Sr-atad5 | 0.008 |
| Sr-hse | 0.351 |
| Sr-mmp | 0.888 |
| Sr-p53 | 0.463 |
| Vol | 427.419 |
| Dense | 0.911 |
| Flex | 0.348 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 1 |
| Qed | 0.623 |
| Synth | 3.251 |
| Fsp3 | 0.44 |
| Mce-18 | 66.667 |
| Natural product-likeness | -0.342 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Accepted |