| General Information | |
|---|---|
| ZINC ID | ZINC000058592126 |
| Molecular Weight (Da) | 427 |
| SMILES | CC(C)(C)C(=O)Nc1ccc2ccn(Cc3cccc(-c4cccc5c4OCO5)c3)c2c1 |
| Molecular Formula | C27N2O3 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 122.223 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| LogP | 5.639 |
| Activity (Ki) in nM | 51.2861 |
| Polar Surface Area (PSA) | 52.49 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | + |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.101 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 21 |
| Fraction csp3 | 0.22 |
| Ilogp | 4.1 |
| Xlogp3 | 5.61 |
| Wlogp | 5.88 |
| Mlogp | 3.82 |
| Silicos-it log p | 5.29 |
| Consensus log p | 4.94 |
| Esol log s | -6.11 |
| Esol solubility (mg/ml) | 0.000332 |
| Esol solubility (mol/l) | 0.00000077 |
| Esol class | Poorly sol |
| Ali log s | -6.47 |
| Ali solubility (mg/ml) | 0.000143 |
| Ali solubility (mol/l) | 0.00000033 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.76 |
| Silicos-it solubility (mg/ml) | 0.00000074 |
| Silicos-it solubility (mol/l) | 1.75E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.92 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.34 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.939 |
| Logd | 4.506 |
| Logp | 5.901 |
| F (20%) | 0.107 |
| F (30%) | 0.399 |
| Mdck | - |
| Ppb | 99.50% |
| Vdss | 1.186 |
| Fu | 0.69% |
| Cyp1a2-inh | 0.865 |
| Cyp1a2-sub | 0.182 |
| Cyp2c19-inh | 0.919 |
| Cyp2c19-sub | 0.061 |
| Cl | 10.875 |
| T12 | 0.065 |
| H-ht | 0.513 |
| Dili | 0.728 |
| Roa | 0.034 |
| Fdamdd | 0.921 |
| Skinsen | 0.645 |
| Ec | 0.003 |
| Ei | 0.012 |
| Respiratory | 0.761 |
| Bcf | 2.815 |
| Igc50 | 4.793 |
| Lc50 | 6.157 |
| Lc50dm | 6.194 |
| Nr-ar | 0.107 |
| Nr-ar-lbd | 0.101 |
| Nr-ahr | 0.955 |
| Nr-aromatase | 0.876 |
| Nr-er | 0.808 |
| Nr-er-lbd | 0.364 |
| Nr-ppar-gamma | 0.01 |
| Sr-are | 0.878 |
| Sr-atad5 | 0.113 |
| Sr-hse | 0.558 |
| Sr-mmp | 0.892 |
| Sr-p53 | 0.718 |
| Vol | 452.129 |
| Dense | 0.943 |
| Flex | 0.222 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 5 |
| Acute aquatic toxicity | - |
| Toxicophores | 3 |
| Qed | 0.431 |
| Synth | 2.471 |
| Fsp3 | 0.222 |
| Mce-18 | 57.697 |
| Natural product-likeness | -0.968 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |