| General Information | |
|---|---|
| ZINC ID | ZINC000058592870 |
| Molecular Weight (Da) | 458 |
| SMILES | CCCCCn1cc(C(=O)NC23CC4CC(CC(C4)C2)C3)c(=O)c2cc(-n3cccc3)ccc21 |
| Molecular Formula | C29N3O2 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 130.435 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| LogP | 5.764 |
| Activity (Ki) in nM | 0.708 |
| Polar Surface Area (PSA) | 56.03 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 1.008 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 15 |
| Fraction csp3 | 0.52 |
| Ilogp | 4.78 |
| Xlogp3 | 6.05 |
| Wlogp | 5.68 |
| Mlogp | 3.68 |
| Silicos-it log p | 4.93 |
| Consensus log p | 5.03 |
| Esol log s | -6.29 |
| Esol solubility (mg/ml) | 0.000236 |
| Esol solubility (mol/l) | 0.00000051 |
| Esol class | Poorly sol |
| Ali log s | -7.01 |
| Ali solubility (mg/ml) | 0.0000451 |
| Ali solubility (mol/l) | 9.86E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -7.62 |
| Silicos-it solubility (mg/ml) | 0.0000109 |
| Silicos-it solubility (mol/l) | 2.38E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.8 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 2 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 5.53 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.51 |
| Logd | 4.562 |
| Logp | 5.858 |
| F (20%) | 0.003 |
| F (30%) | 0.191 |
| Mdck | 2.56E-05 |
| Ppb | 0.9601 |
| Vdss | 1.188 |
| Fu | 0.0233 |
| Cyp1a2-inh | 0.209 |
| Cyp1a2-sub | 0.144 |
| Cyp2c19-inh | 0.774 |
| Cyp2c19-sub | 0.068 |
| Cl | 2.041 |
| T12 | 0.012 |
| H-ht | 0.452 |
| Dili | 0.278 |
| Roa | 0.12 |
| Fdamdd | 0.916 |
| Skinsen | 0.25 |
| Ec | 0.003 |
| Ei | 0.011 |
| Respiratory | 0.249 |
| Bcf | 2.22 |
| Igc50 | 4.778 |
| Lc50 | 5.603 |
| Lc50dm | 5.816 |
| Nr-ar | 0.001 |
| Nr-ar-lbd | 0.002 |
| Nr-ahr | 0.866 |
| Nr-aromatase | 0.849 |
| Nr-er | 0.389 |
| Nr-er-lbd | 0.004 |
| Nr-ppar-gamma | 0.018 |
| Sr-are | 0.765 |
| Sr-atad5 | 0.025 |
| Sr-hse | 0.943 |
| Sr-mmp | 0.81 |
| Sr-p53 | 0.901 |
| Vol | 488.28 |
| Dense | 0.936 |
| Flex | 0.267 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 3 |
| Qed | 0.464 |
| Synth | 3.829 |
| Fsp3 | 0.517 |
| Mce-18 | 78.545 |
| Natural product-likeness | -1.327 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Accepted |