| General Information | |
|---|---|
| ZINC ID | ZINC000064528042 |
| Molecular Weight (Da) | 614 |
| SMILES | COc1ccc2c(c1)cc(S(=O)(=O)N1CCC(CNS(=O)(=O)C(F)(F)F)CC1)n2S(=O)(=O)c1ccccc1F |
| Molecular Formula | C22F4N3O7S3 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 132.012 |
| HBA | 7 |
| HBD | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| LogP | 4.771 |
| Activity (Ki) in nM | 0.794 |
| Polar Surface Area (PSA) | 156.99 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.02030813 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 15 |
| Fraction csp3 | 0.36 |
| Ilogp | 3.23 |
| Xlogp3 | 3.84 |
| Wlogp | 7.41 |
| Mlogp | 2.09 |
| Silicos-it log p | 0.85 |
| Consensus log p | 3.48 |
| Esol log s | -5.75 |
| Esol solubility (mg/ml) | 1.08E-03 |
| Esol solubility (mol/l) | 1.76E-06 |
| Esol class | Moderately |
| Ali log s | -6.83 |
| Ali solubility (mg/ml) | 9.02E-05 |
| Ali solubility (mol/l) | 1.47E-07 |
| Ali class | Poorly sol |
| Silicos-it logsw | -6.67 |
| Silicos-it solubility (mg/ml) | 1.30E-04 |
| Silicos-it solubility (mol/l) | 2.12E-07 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -7.32 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 3 |
| Veber number of violations | 1 |
| Egan number of violations | 2 |
| Muegge number of violations | 3 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 4.01 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.566 |
| Logd | 3.449 |
| Logp | 4.72 |
| F (20%) | 0.029 |
| F (30%) | 0.018 |
| Mdck | 3.26E-05 |
| Ppb | 0.9566 |
| Vdss | 0.406 |
| Fu | 0.0899 |
| Cyp1a2-inh | 0.245 |
| Cyp1a2-sub | 0.471 |
| Cyp2c19-inh | 0.833 |
| Cyp2c19-sub | 0.646 |
| Cl | 4.479 |
| T12 | 0.032 |
| H-ht | 0.982 |
| Dili | 0.993 |
| Roa | 0.03 |
| Fdamdd | 0.987 |
| Skinsen | 0.016 |
| Ec | 0.003 |
| Ei | 0.011 |
| Respiratory | 0.83 |
| Bcf | 1.086 |
| Igc50 | 3.913 |
| Lc50 | 4.689 |
| Lc50dm | 5.733 |
| Nr-ar | 0.001 |
| Nr-ar-lbd | 0.029 |
| Nr-ahr | 0.107 |
| Nr-aromatase | 0.39 |
| Nr-er | 0.096 |
| Nr-er-lbd | 0.007 |
| Nr-ppar-gamma | 0.013 |
| Sr-are | 0.788 |
| Sr-atad5 | 0.004 |
| Sr-hse | 0.006 |
| Sr-mmp | 0.518 |
| Sr-p53 | 0.01 |
| Vol | 510.706 |
| Dense | 1.2 |
| Flex | 28 |
| Nstereo | 0.321 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 1 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 2 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 2 |
| Qed | 2 |
| Synth | 0.387 |
| Fsp3 | 2.942 |
| Mce-18 | 0.364 |
| Natural product-likeness | 77 |
| Alarm nmr | -1.261 |
| Bms | 3 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Accepted |
| Goldentriangle | Rejected |