| General Information | |
|---|---|
| ZINC ID | ZINC000064539845 |
| Molecular Weight (Da) | 396 |
| SMILES | COc1cccc2c(C(=O)N3CCN4CCC[C@@H]4C3)cn(CC3CCCCC3)c12 |
| Molecular Formula | C24N3O2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 113.765 |
| HBA | 2 |
| HBD | 0 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| LogP | 4.135 |
| Activity (Ki) in nM | 63.0957 |
| Polar Surface Area (PSA) | 37.71 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | + |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 0.869 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 9 |
| Fraction csp3 | 0.62 |
| Ilogp | 4.03 |
| Xlogp3 | 4.1 |
| Wlogp | 3.39 |
| Mlogp | 2.98 |
| Silicos-it log p | 3.17 |
| Consensus log p | 3.53 |
| Esol log s | -4.77 |
| Esol solubility (mg/ml) | 0.00664 |
| Esol solubility (mol/l) | 0.0000168 |
| Esol class | Moderately |
| Ali log s | -4.6 |
| Ali solubility (mg/ml) | 0.00999 |
| Ali solubility (mol/l) | 0.0000253 |
| Ali class | Moderately |
| Silicos-it logsw | -4.68 |
| Silicos-it solubility (mg/ml) | 0.00821 |
| Silicos-it solubility (mol/l) | 0.0000207 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.8 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.85 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.573 |
| Logd | 3.808 |
| Logp | 4.397 |
| F (20%) | 0.944 |
| F (30%) | 0.002 |
| Mdck | - |
| Ppb | 83.75% |
| Vdss | 1.37 |
| Fu | 8.34% |
| Cyp1a2-inh | 0.12 |
| Cyp1a2-sub | 0.938 |
| Cyp2c19-inh | 0.575 |
| Cyp2c19-sub | 0.929 |
| Cl | 4.392 |
| T12 | 0.038 |
| H-ht | 0.98 |
| Dili | 0.873 |
| Roa | 0.262 |
| Fdamdd | 0.215 |
| Skinsen | 0.41 |
| Ec | 0.003 |
| Ei | 0.014 |
| Respiratory | 0.885 |
| Bcf | 1.242 |
| Igc50 | 4.518 |
| Lc50 | 4.333 |
| Lc50dm | 4.925 |
| Nr-ar | 0.554 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.247 |
| Nr-aromatase | 0.033 |
| Nr-er | 0.237 |
| Nr-er-lbd | 0.004 |
| Nr-ppar-gamma | 0.008 |
| Sr-are | 0.399 |
| Sr-atad5 | 0.007 |
| Sr-hse | 0.283 |
| Sr-mmp | 0.127 |
| Sr-p53 | 0.032 |
| Vol | 418.266 |
| Dense | 0.945 |
| Flex | 0.185 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 2 |
| Qed | 0.78 |
| Synth | 2.874 |
| Fsp3 | 0.625 |
| Mce-18 | 91.667 |
| Natural product-likeness | -1.124 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |