| General Information | |
|---|---|
| ZINC ID | ZINC000064548499 |
| Molecular Weight (Da) | 397 |
| SMILES | CCCC/C=CC1(c2cc(O)c3c(c2)OC(C)(C)[C@@H]2CCC(=O)C[C@@H]32)CCCC1 |
| Molecular Formula | C26O3 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 118.43 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| LogP | 5.986 |
| Activity (Ki) in nM | 5.248 |
| Polar Surface Area (PSA) | 46.53 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.899 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.65 |
| Ilogp | 4 |
| Xlogp3 | 6.61 |
| Wlogp | 6.57 |
| Mlogp | 4.49 |
| Silicos-it log p | 6.7 |
| Consensus log p | 5.68 |
| Esol log s | -6.29 |
| Esol solubility (mg/ml) | 0.000205 |
| Esol solubility (mol/l) | 0.00000051 |
| Esol class | Poorly sol |
| Ali log s | -7.39 |
| Ali solubility (mg/ml) | 0.0000162 |
| Ali solubility (mol/l) | 0.00000004 |
| Ali class | Poorly sol |
| Silicos-it logsw | -6.68 |
| Silicos-it solubility (mg/ml) | 0.0000819 |
| Silicos-it solubility (mol/l) | 0.0000002 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.03 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 1 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 4.59 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -3.052 |
| Logd | 5.257 |
| Logp | 6.456 |
| F (20%) | 1 |
| F (30%) | 0.985 |
| Mdck | 1.73E-05 |
| Ppb | 0.9984 |
| Vdss | 1.555 |
| Fu | 0.0122 |
| Cyp1a2-inh | 0.109 |
| Cyp1a2-sub | 0.944 |
| Cyp2c19-inh | 0.768 |
| Cyp2c19-sub | 0.856 |
| Cl | 3.016 |
| T12 | 0.441 |
| H-ht | 0.396 |
| Dili | 0.04 |
| Roa | 0.706 |
| Fdamdd | 0.938 |
| Skinsen | 0.046 |
| Ec | 0.003 |
| Ei | 0.07 |
| Respiratory | 0.945 |
| Bcf | 2.476 |
| Igc50 | 5.162 |
| Lc50 | 5.76 |
| Lc50dm | 5.757 |
| Nr-ar | 0.036 |
| Nr-ar-lbd | 0.059 |
| Nr-ahr | 0.771 |
| Nr-aromatase | 0.843 |
| Nr-er | 0.761 |
| Nr-er-lbd | 0.677 |
| Nr-ppar-gamma | 0.978 |
| Sr-are | 0.857 |
| Sr-atad5 | 0.033 |
| Sr-hse | 0.841 |
| Sr-mmp | 0.98 |
| Sr-p53 | 0.967 |
| Vol | 437.215 |
| Dense | 0.906 |
| Flex | 0.217 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 2 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 1 |
| Qed | 0.452 |
| Synth | 4.046 |
| Fsp3 | 0.654 |
| Mce-18 | 87.791 |
| Natural product-likeness | 2.096 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Rejected |