| General Information | |
|---|---|
| ZINC ID | ZINC000064548621 |
| Molecular Weight (Da) | 387 |
| SMILES | CCCCCCC1(c2cc(O)c3c(c2)OC(C)(C)[C@@H]2CC[C@@H](O)C[C@@H]32)CCC1 |
| Molecular Formula | C25H38O3 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 113.74 |
| HBA | 3 |
| HBD | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| LogP | 6.301 |
| Activity (Ki) in nM | 0.1585 |
| Polar Surface Area (PSA) | 49.69 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | + |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.849 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.76 |
| Ilogp | 4.3 |
| Xlogp3 | 7.17 |
| Wlogp | 6.2 |
| Mlogp | 4.46 |
| Silicos-it log p | 6.05 |
| Consensus log p | 5.64 |
| Esol log s | -6.52 |
| Esol solubility (mg/ml) | 0.000118 |
| Esol solubility (mol/l) | 0.0000003 |
| Esol class | Poorly sol |
| Ali log s | -8.03 |
| Ali solubility (mg/ml) | 0.00000357 |
| Ali solubility (mol/l) | 9.23E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -6.44 |
| Silicos-it solubility (mg/ml) | 0.00014 |
| Silicos-it solubility (mol/l) | 0.00000036 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -3.57 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 4.76 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -3.978 |
| Logd | 5.328 |
| Logp | 7.606 |
| F (20%) | 0.964 |
| F (30%) | 0.94 |
| Mdck | - |
| Ppb | 99.20% |
| Vdss | 2.081 |
| Fu | 1.68% |
| Cyp1a2-inh | 0.143 |
| Cyp1a2-sub | 0.909 |
| Cyp2c19-inh | 0.594 |
| Cyp2c19-sub | 0.868 |
| Cl | 3.66 |
| T12 | 0.082 |
| H-ht | 0.774 |
| Dili | 0.022 |
| Roa | 0.209 |
| Fdamdd | 0.97 |
| Skinsen | 0.171 |
| Ec | 0.004 |
| Ei | 0.283 |
| Respiratory | 0.867 |
| Bcf | 2.566 |
| Igc50 | 5.227 |
| Lc50 | 6.301 |
| Lc50dm | 5.946 |
| Nr-ar | 0.426 |
| Nr-ar-lbd | 0.004 |
| Nr-ahr | 0.431 |
| Nr-aromatase | 0.803 |
| Nr-er | 0.278 |
| Nr-er-lbd | 0.252 |
| Nr-ppar-gamma | 0.854 |
| Sr-are | 0.745 |
| Sr-atad5 | 0.006 |
| Sr-hse | 0.653 |
| Sr-mmp | 0.966 |
| Sr-p53 | 0.828 |
| Vol | 425.192 |
| Dense | 0.908 |
| Flex | 0.3 |
| Nstereo | 3 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | - |
| Toxicophores | 1 |
| Qed | 0.572 |
| Synth | 3.85 |
| Fsp3 | 0.76 |
| Mce-18 | 87.5 |
| Natural product-likeness | 2.113 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |