| General Information | |
|---|---|
| ZINC ID | ZINC000064548837 |
| Molecular Weight (Da) | 385 |
| SMILES | CCCCCCC1(c2cc(O)c3c(c2)OC(C)(C)[C@@H]2CCC(=O)C[C@@H]32)CCC1 |
| Molecular Formula | C25O3 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 112.713 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| LogP | 5.975 |
| Activity (Ki) in nM | 0.8318 |
| Polar Surface Area (PSA) | 46.53 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | + |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.899 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.72 |
| Ilogp | 4.06 |
| Xlogp3 | 6.76 |
| Wlogp | 6.41 |
| Mlogp | 4.37 |
| Silicos-it log p | 6.63 |
| Consensus log p | 5.65 |
| Esol log s | -6.25 |
| Esol solubility (mg/ml) | 0.000218 |
| Esol solubility (mol/l) | 0.00000056 |
| Esol class | Poorly sol |
| Ali log s | -7.54 |
| Ali solubility (mg/ml) | 0.000011 |
| Ali solubility (mol/l) | 2.86E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -7.14 |
| Silicos-it solubility (mg/ml) | 0.0000281 |
| Silicos-it solubility (mol/l) | 7.31E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -3.85 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 4.44 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -3.416 |
| Logd | 5.372 |
| Logp | 7.199 |
| F (20%) | 0.999 |
| F (30%) | 0.999 |
| Mdck | - |
| Ppb | 99.00% |
| Vdss | 1.63 |
| Fu | 1.67% |
| Cyp1a2-inh | 0.122 |
| Cyp1a2-sub | 0.915 |
| Cyp2c19-inh | 0.628 |
| Cyp2c19-sub | 0.853 |
| Cl | 2.95 |
| T12 | 0.136 |
| H-ht | 0.474 |
| Dili | 0.046 |
| Roa | 0.407 |
| Fdamdd | 0.932 |
| Skinsen | 0.041 |
| Ec | 0.003 |
| Ei | 0.087 |
| Respiratory | 0.93 |
| Bcf | 2.207 |
| Igc50 | 5.078 |
| Lc50 | 5.773 |
| Lc50dm | 5.657 |
| Nr-ar | 0.18 |
| Nr-ar-lbd | 0.008 |
| Nr-ahr | 0.774 |
| Nr-aromatase | 0.785 |
| Nr-er | 0.567 |
| Nr-er-lbd | 0.366 |
| Nr-ppar-gamma | 0.968 |
| Sr-are | 0.827 |
| Sr-atad5 | 0.011 |
| Sr-hse | 0.618 |
| Sr-mmp | 0.975 |
| Sr-p53 | 0.945 |
| Vol | 422.555 |
| Dense | 0.909 |
| Flex | 0.286 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 2 |
| Acute aquatic toxicity | - |
| Toxicophores | 1 |
| Qed | 0.577 |
| Synth | 3.679 |
| Fsp3 | 0.72 |
| Mce-18 | 86.628 |
| Natural product-likeness | 2.089 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |