| General Information | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000064548838 |
| Molecular Weight (Da) | 449 |
| SMILES | CC1(C)Oc2cc(C3(CCCCBr)CCCC3)cc(O)c2[C@@H]2CC(=O)CC[C@H]21 |
| Molecular Formula | C24Br1O3 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000064548838 |
| Molar Refractivity | 116.074 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| LogP | 5.642 |
| Activity (Ki) in nM | 13.804 |
| Polar Surface Area (PSA) | 46.53 |
| Pharmacokinetic Properties | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000064548838 |
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | + |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Oatp2b1 inhibitor | - |
| Oatp1b1 inhibitor | + |
| Oatp1b3 inhibitor | + |
| Mate1 inhibitor | - |
| Oct2 inhibitor | - |
| Bsep inhibitor | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.785 |
| Pharmacokinetic Properties | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.71 |
| Ilogp | 3.9 |
| Xlogp3 | 6.07 |
| Wlogp | 6.39 |
| Mlogp | 4.47 |
| Silicos-it log p | 6.63 |
| Consensus log p | 5.49 |
| Esol log s | -6.28 |
| Esol solubility (mg/ml) | 0.000236 |
| Esol solubility (mol/l) | 0.00000052 |
| Esol class | Poorly sol |
| Ali log s | -6.83 |
| Ali solubility (mg/ml) | 0.0000669 |
| Ali solubility (mol/l) | 0.00000014 |
| Ali class | Poorly sol |
| Silicos-it logsw | -7.42 |
| Silicos-it solubility (mg/ml) | 0.0000172 |
| Silicos-it solubility (mol/l) | 3.84E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.73 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 1 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 4.47 |
| Pharmacokinetic Properties | |
|---|---|
| Logs | -3.834 |
| Logd | 5.031 |
| Logp | 6.792 |
| F (20%) | 0.968 |
| F (30%) | 0.992 |
| Mdck | 1.25E-05 |
| Ppb | 0.9864 |
| Vdss | 1.308 |
| Fu | 0.0149 |
| Cyp1a2-inh | 0.135 |
| Cyp1a2-sub | 0.914 |
| Cyp2c19-inh | 0.573 |
| Cyp2c19-sub | 0.798 |
| Cl | 1.937 |
| T12 | 0.138 |
| H-ht | 0.612 |
| Dili | 0.1 |
| Roa | 0.815 |
| Fdamdd | 0.932 |
| Skinsen | 0.051 |
| Ec | 0.003 |
| Ei | 0.074 |
| Respiratory | 0.937 |
| Bcf | 1.716 |
| Igc50 | 5.06 |
| Lc50 | 5.946 |
| Lc50dm | 5.764 |
| Nr-ar | 0.064 |
| Nr-ar-lbd | 0.015 |
| Nr-ahr | 0.793 |
| Nr-aromatase | 0.79 |
| Nr-er | 0.581 |
| Nr-er-lbd | 0.175 |
| Nr-ppar-gamma | 0.967 |
| Sr-are | 0.833 |
| Sr-atad5 | 0.012 |
| Sr-hse | 0.889 |
| Sr-mmp | 0.967 |
| Sr-p53 | 0.969 |
| Vol | 424.543 |
| Dense | 1.056 |
| Flex | 0.227 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 4 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 3 |
| Acute aquatic toxicity | 2 |
| Toxicophores | 2 |
| Qed | 0.418 |
| Synth | 3.861 |
| Fsp3 | 0.708 |
| Mce-18 | 88.415 |
| Natural product-likeness | 1.977 |
| Alarm nmr | 1 |
| Bms | 1 |
| Chelating | 0 |
| Pfizer | 2 |
| Gsk | Rejected |
| Goldentriangle | Rejected |