| General Information | |
|---|---|
| ZINC ID | ZINC000064549475 |
| Molecular Weight (Da) | 451 |
| SMILES | CC1(C)Oc2cc(C3(CCCCCBr)CCC3)cc(O)c2[C@@H]2C[C@H](O)CC[C@H]21 |
| Molecular Formula | C24Br1O3 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 117.102 |
| HBA | 3 |
| HBD | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| LogP | 5.968 |
| Activity (Ki) in nM | 1.622 |
| Polar Surface Area (PSA) | 49.69 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | + |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.848 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.75 |
| Ilogp | 4.28 |
| Xlogp3 | 6.48 |
| Wlogp | 6.18 |
| Mlogp | 4.56 |
| Silicos-it log p | 6.19 |
| Consensus log p | 5.54 |
| Esol log s | -6.48 |
| Esol solubility (mg/ml) | 0.000148 |
| Esol solubility (mol/l) | 0.00000032 |
| Esol class | Poorly sol |
| Ali log s | -7.32 |
| Ali solubility (mg/ml) | 0.0000217 |
| Ali solubility (mol/l) | 0.00000004 |
| Ali class | Poorly sol |
| Silicos-it logsw | -6.84 |
| Silicos-it solubility (mg/ml) | 0.0000645 |
| Silicos-it solubility (mol/l) | 0.00000014 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.45 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 1 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 4.83 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.321 |
| Logd | 4.953 |
| Logp | 7.141 |
| F (20%) | 0.045 |
| F (30%) | 0.533 |
| Mdck | 1.78E-05 |
| Ppb | 0.991 |
| Vdss | 1.799 |
| Fu | 0.0159 |
| Cyp1a2-inh | 0.169 |
| Cyp1a2-sub | 0.914 |
| Cyp2c19-inh | 0.546 |
| Cyp2c19-sub | 0.857 |
| Cl | 2.315 |
| T12 | 0.084 |
| H-ht | 0.85 |
| Dili | 0.036 |
| Roa | 0.637 |
| Fdamdd | 0.971 |
| Skinsen | 0.174 |
| Ec | 0.004 |
| Ei | 0.236 |
| Respiratory | 0.885 |
| Bcf | 2.476 |
| Igc50 | 5.185 |
| Lc50 | 6.423 |
| Lc50dm | 6.062 |
| Nr-ar | 0.487 |
| Nr-ar-lbd | 0.004 |
| Nr-ahr | 0.698 |
| Nr-aromatase | 0.864 |
| Nr-er | 0.253 |
| Nr-er-lbd | 0.038 |
| Nr-ppar-gamma | 0.875 |
| Sr-are | 0.785 |
| Sr-atad5 | 0.007 |
| Sr-hse | 0.933 |
| Sr-mmp | 0.953 |
| Sr-p53 | 0.942 |
| Vol | 427.179 |
| Dense | 1.054 |
| Flex | 0.3 |
| Nstereo | 3 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 4 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 2 |
| Acute aquatic toxicity | 2 |
| Toxicophores | 2 |
| Qed | 0.401 |
| Synth | 4.009 |
| Fsp3 | 0.75 |
| Mce-18 | 88.095 |
| Natural product-likeness | 2.074 |
| Alarm nmr | 1 |
| Bms | 1 |
| Chelating | 0 |
| Pfizer | 2 |
| Gsk | Rejected |
| Goldentriangle | Accepted |