| General Information | |
|---|---|
| ZINC ID | ZINC000066252420 |
| Molecular Weight (Da) | 387 |
| SMILES | FC(F)(F)c1cccc(-c2c[nH]c(-c3cccc(CN4CCOCC4)c3)n2)c1 |
| Molecular Formula | C21F3N3O1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 102.457 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| LogP | 3.822 |
| Activity (Ki) in nM | 1000 |
| Polar Surface Area (PSA) | 41.15 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | - |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | + |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | + |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.94327032 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 17 |
| Fraction csp3 | 0.29 |
| Ilogp | 3.18 |
| Xlogp3 | 3.73 |
| Wlogp | 5.21 |
| Mlogp | 3.03 |
| Silicos-it log p | 5.34 |
| Consensus log p | 4.1 |
| Esol log s | -4.71 |
| Esol solubility (mg/ml) | 0.00754 |
| Esol solubility (mol/l) | 0.0000195 |
| Esol class | Moderately |
| Ali log s | -4.29 |
| Ali solubility (mg/ml) | 0.0201 |
| Ali solubility (mol/l) | 0.0000518 |
| Ali class | Moderately |
| Silicos-it logsw | -7.68 |
| Silicos-it solubility (mg/ml) | 0.00000811 |
| Silicos-it solubility (mol/l) | 2.09E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.01 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.09 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.214 |
| Logd | 4.15 |
| Logp | 4.252 |
| F (20%) | 0.01 |
| F (30%) | 0.009 |
| Mdck | - |
| Ppb | 96.86% |
| Vdss | 2.066 |
| Fu | 4.04% |
| Cyp1a2-inh | 0.905 |
| Cyp1a2-sub | 0.454 |
| Cyp2c19-inh | 0.881 |
| Cyp2c19-sub | 0.07 |
| Cl | 10.403 |
| T12 | 0.109 |
| H-ht | 0.64 |
| Dili | 0.205 |
| Roa | 0.593 |
| Fdamdd | 0.932 |
| Skinsen | 0.091 |
| Ec | 0.003 |
| Ei | 0.011 |
| Respiratory | 0.781 |
| Bcf | 2.066 |
| Igc50 | 4.182 |
| Lc50 | 5.493 |
| Lc50dm | 6.416 |
| Nr-ar | 0.008 |
| Nr-ar-lbd | 0.01 |
| Nr-ahr | 0.566 |
| Nr-aromatase | 0.944 |
| Nr-er | 0.619 |
| Nr-er-lbd | 0.031 |
| Nr-ppar-gamma | 0.009 |
| Sr-are | 0.758 |
| Sr-atad5 | 0.039 |
| Sr-hse | 0.2 |
| Sr-mmp | 0.306 |
| Sr-p53 | 0.443 |
| Vol | 376.438 |
| Dense | 1.028 |
| Flex | 0.217 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 0 |
| Qed | 0.712 |
| Synth | 2.499 |
| Fsp3 | 0.286 |
| Mce-18 | 50.519 |
| Natural product-likeness | -1.556 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |