| General Information | |
|---|---|
| ZINC ID | ZINC000066258380 |
| Molecular Weight (Da) | 421 |
| SMILES | Cc1c(C(=O)NCCCCCO)nn(-c2ccc(Cl)cc2Cl)c1-n1cccc1 |
| Molecular Formula | C20Cl2N4O2 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 110.495 |
| HBA | 3 |
| HBD | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| LogP | 4.295 |
| Activity (Ki) in nM | 2344.229 |
| Polar Surface Area (PSA) | 72.08 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | - |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.94535833 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 16 |
| Fraction csp3 | 0.3 |
| Ilogp | 3.44 |
| Xlogp3 | 4.24 |
| Wlogp | 4.17 |
| Mlogp | 3.27 |
| Silicos-it log p | 3.81 |
| Consensus log p | 3.78 |
| Esol log s | -4.95 |
| Esol solubility (mg/ml) | 0.0047 |
| Esol solubility (mol/l) | 0.0000112 |
| Esol class | Moderately |
| Ali log s | -5.46 |
| Ali solubility (mg/ml) | 0.00145 |
| Ali solubility (mol/l) | 0.00000343 |
| Ali class | Moderately |
| Silicos-it logsw | -6.8 |
| Silicos-it solubility (mg/ml) | 0.0000666 |
| Silicos-it solubility (mol/l) | 0.00000015 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.86 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.16 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.437 |
| Logd | 3.407 |
| Logp | 3.739 |
| F (20%) | 0.001 |
| F (30%) | 0.002 |
| Mdck | 1.88E-05 |
| Ppb | 0.9602 |
| Vdss | 1.166 |
| Fu | 0.0372 |
| Cyp1a2-inh | 0.77 |
| Cyp1a2-sub | 0.706 |
| Cyp2c19-inh | 0.936 |
| Cyp2c19-sub | 0.452 |
| Cl | 6.67 |
| T12 | 0.317 |
| H-ht | 0.389 |
| Dili | 0.963 |
| Roa | 0.059 |
| Fdamdd | 0.387 |
| Skinsen | 0.204 |
| Ec | 0.003 |
| Ei | 0.012 |
| Respiratory | 0.023 |
| Bcf | 1.226 |
| Igc50 | 3.791 |
| Lc50 | 4.665 |
| Lc50dm | 4.059 |
| Nr-ar | 0.01 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.916 |
| Nr-aromatase | 0.972 |
| Nr-er | 0.31 |
| Nr-er-lbd | 0.006 |
| Nr-ppar-gamma | 0.188 |
| Sr-are | 0.758 |
| Sr-atad5 | 0.373 |
| Sr-hse | 0.404 |
| Sr-mmp | 0.624 |
| Sr-p53 | 0.924 |
| Vol | 399.705 |
| Dense | 1.051 |
| Flex | 0.529 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 2 |
| Qed | 0.537 |
| Synth | 2.57 |
| Fsp3 | 0.3 |
| Mce-18 | 18 |
| Natural product-likeness | -1.516 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Accepted |