| General Information | |
|---|---|
| ZINC ID | ZINC000066259245 |
| Molecular Weight (Da) | 405 |
| SMILES | CCCNC(=O)c1nn(-c2ccc(Cl)cc2Cl)c(-n2c(C)ccc2C)c1C |
| Molecular Formula | C20Cl2N4O1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 109.164 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| LogP | 5.174 |
| Activity (Ki) in nM | 1949.845 |
| Polar Surface Area (PSA) | 51.85 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.04776513 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 16 |
| Fraction csp3 | 0.3 |
| Ilogp | 4.12 |
| Xlogp3 | 5.55 |
| Wlogp | 5.03 |
| Mlogp | 4.08 |
| Silicos-it log p | 4.67 |
| Consensus log p | 4.69 |
| Esol log s | -5.89 |
| Esol solubility (mg/ml) | 0.00052 |
| Esol solubility (mol/l) | 0.00000128 |
| Esol class | Moderately |
| Ali log s | -6.4 |
| Ali solubility (mg/ml) | 0.000162 |
| Ali solubility (mol/l) | 0.00000039 |
| Ali class | Poorly sol |
| Silicos-it logsw | -7.34 |
| Silicos-it solubility (mg/ml) | 0.0000187 |
| Silicos-it solubility (mol/l) | 0.00000004 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.83 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.23 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.356 |
| Logd | 3.552 |
| Logp | 4.886 |
| F (20%) | 0.002 |
| F (30%) | 0.001 |
| Mdck | 1.29E-05 |
| Ppb | 0.9706 |
| Vdss | 0.892 |
| Fu | 0.0261 |
| Cyp1a2-inh | 0.331 |
| Cyp1a2-sub | 0.951 |
| Cyp2c19-inh | 0.949 |
| Cyp2c19-sub | 0.921 |
| Cl | 6.03 |
| T12 | 0.361 |
| H-ht | 0.373 |
| Dili | 0.933 |
| Roa | 0.323 |
| Fdamdd | 0.803 |
| Skinsen | 0.067 |
| Ec | 0.003 |
| Ei | 0.011 |
| Respiratory | 0.262 |
| Bcf | 2.219 |
| Igc50 | 4.509 |
| Lc50 | 5.63 |
| Lc50dm | 5.329 |
| Nr-ar | 0.027 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.778 |
| Nr-aromatase | 0.92 |
| Nr-er | 0.487 |
| Nr-er-lbd | 0.013 |
| Nr-ppar-gamma | 0.025 |
| Sr-are | 0.728 |
| Sr-atad5 | 0.369 |
| Sr-hse | 0.021 |
| Sr-mmp | 0.321 |
| Sr-p53 | 0.836 |
| Vol | 390.915 |
| Dense | 1.034 |
| Flex | 0.353 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 2 |
| Qed | 0.647 |
| Synth | 2.54 |
| Fsp3 | 0.3 |
| Mce-18 | 20 |
| Natural product-likeness | -1.832 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Accepted |