| General Information | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000066259438 |
| Molecular Weight (Da) | 419 |
| SMILES | Cc1c(C(=O)NC(C)(C)C)nn(-c2ccc(Cl)cc2Cl)c1-n1c(C)ccc1C |
| Molecular Formula | C21Cl2N4O1 |
| Action | Antagonist |
| General Information | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000066259438 |
| Molecular Weight (Da) | 419 |
| SMILES | Cc1c(C(=O)NC(C)(C)C)nn(-c2ccc(Cl)cc2Cl)c1-n1c(C)ccc1C |
| Molecular Formula | C21Cl2N4O1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000066259438 |
| Molar Refractivity | 113.696 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| LogP | 5.232 |
| Activity (Ki) in nM | 20.417 |
| Polar Surface Area (PSA) | 51.85 |
| Pharmacokinetic Properties | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000066259438 |
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Oatp2b1 inhibitor | - |
| Oatp1b1 inhibitor | + |
| Oatp1b3 inhibitor | + |
| Mate1 inhibitor | - |
| Oct2 inhibitor | - |
| Bsep inhibitor | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.71062755 |
| Pharmacokinetic Properties | |
|---|---|
| Number of aromatic heavy atoms | 16 |
| Fraction csp3 | 0.33 |
| Ilogp | 4.42 |
| Xlogp3 | 5.64 |
| Wlogp | 5.42 |
| Mlogp | 4.29 |
| Silicos-it log p | 4.75 |
| Consensus log p | 4.9 |
| Esol log s | -6.09 |
| Esol solubility (mg/ml) | 0.000344 |
| Esol solubility (mol/l) | 0.00000082 |
| Esol class | Poorly sol |
| Ali log s | -6.49 |
| Ali solubility (mg/ml) | 0.000135 |
| Ali solubility (mol/l) | 0.00000032 |
| Ali class | Poorly sol |
| Silicos-it logsw | -7.34 |
| Silicos-it solubility (mg/ml) | 0.0000193 |
| Silicos-it solubility (mol/l) | 4.59E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.85 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.37 |
| Pharmacokinetic Properties | |
|---|---|
| Logs | -5.959 |
| Logd | 3.822 |
| Logp | 5.076 |
| F (20%) | 0.002 |
| F (30%) | 0.002 |
| Mdck | 7.83E-06 |
| Ppb | 0.988 |
| Vdss | 1.401 |
| Fu | 0.0141 |
| Cyp1a2-inh | 0.205 |
| Cyp1a2-sub | 0.944 |
| Cyp2c19-inh | 0.938 |
| Cyp2c19-sub | 0.942 |
| Cl | 3.662 |
| T12 | 0.367 |
| H-ht | 0.202 |
| Dili | 0.964 |
| Roa | 0.499 |
| Fdamdd | 0.873 |
| Skinsen | 0.054 |
| Ec | 0.003 |
| Ei | 0.011 |
| Respiratory | 0.488 |
| Bcf | 2.851 |
| Igc50 | 4.291 |
| Lc50 | 5.862 |
| Lc50dm | 5.06 |
| Nr-ar | 0.003 |
| Nr-ar-lbd | 0.002 |
| Nr-ahr | 0.909 |
| Nr-aromatase | 0.918 |
| Nr-er | 0.651 |
| Nr-er-lbd | 0.16 |
| Nr-ppar-gamma | 0.009 |
| Sr-are | 0.682 |
| Sr-atad5 | 0.006 |
| Sr-hse | 0.099 |
| Sr-mmp | 0.619 |
| Sr-p53 | 0.644 |
| Vol | 408.211 |
| Dense | 1.024 |
| Flex | 0.294 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 3 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 2 |
| Qed | 0.616 |
| Synth | 2.663 |
| Fsp3 | 0.333 |
| Mce-18 | 23 |
| Natural product-likeness | -1.701 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Accepted |