| General Information | |
|---|---|
| ZINC ID | ZINC000066259453 |
| Molecular Weight (Da) | 352 |
| SMILES | Clc1cccc(-c2c[nH]c(-c3cccc(CN4CCCCC4)c3)n2)c1 |
| Molecular Formula | C21Cl1N3 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 104.355 |
| HBA | 1 |
| HBD | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| LogP | 4.774 |
| Activity (Ki) in nM | 10 |
| Polar Surface Area (PSA) | 31.92 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | + |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | + |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.8799498 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 17 |
| Fraction csp3 | 0.29 |
| Ilogp | 3.41 |
| Xlogp3 | 4.69 |
| Wlogp | 4.85 |
| Mlogp | 3.78 |
| Silicos-it log p | 5.59 |
| Consensus log p | 4.46 |
| Esol log s | -5.22 |
| Esol solubility (mg/ml) | 0.00214 |
| Esol solubility (mol/l) | 0.00000609 |
| Esol class | Moderately |
| Ali log s | -5.09 |
| Ali solubility (mg/ml) | 0.00287 |
| Ali solubility (mol/l) | 0.00000816 |
| Ali class | Moderately |
| Silicos-it logsw | -7.97 |
| Silicos-it solubility (mg/ml) | 0.00000374 |
| Silicos-it solubility (mol/l) | 1.06E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.12 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 2.73 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.307 |
| Logd | 4.548 |
| Logp | 5.083 |
| F (20%) | 0.081 |
| F (30%) | 0.014 |
| Mdck | 6.26E-06 |
| Ppb | 0.9754 |
| Vdss | 3.313 |
| Fu | 0.0244 |
| Cyp1a2-inh | 0.918 |
| Cyp1a2-sub | 0.748 |
| Cyp2c19-inh | 0.726 |
| Cyp2c19-sub | 0.068 |
| Cl | 9.796 |
| T12 | 0.151 |
| H-ht | 0.329 |
| Dili | 0.43 |
| Roa | 0.683 |
| Fdamdd | 0.909 |
| Skinsen | 0.683 |
| Ec | 0.003 |
| Ei | 0.013 |
| Respiratory | 0.806 |
| Bcf | 2.533 |
| Igc50 | 4.958 |
| Lc50 | 5.943 |
| Lc50dm | 5.983 |
| Nr-ar | 0.045 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.673 |
| Nr-aromatase | 0.955 |
| Nr-er | 0.625 |
| Nr-er-lbd | 0.012 |
| Nr-ppar-gamma | 0.007 |
| Sr-are | 0.783 |
| Sr-atad5 | 0.562 |
| Sr-hse | 0.788 |
| Sr-mmp | 0.565 |
| Sr-p53 | 0.36 |
| Vol | 364.656 |
| Dense | 0.963 |
| Flex | 0.174 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 0 |
| Qed | 0.684 |
| Synth | 2.326 |
| Fsp3 | 0.286 |
| Mce-18 | 45.037 |
| Natural product-likeness | -1.37 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Accepted |