| General Information | |
|---|---|
| ZINC ID | ZINC000068244526 |
| Molecular Weight (Da) | 490 |
| SMILES | CC(=O)N1CCC(Cn2c(CC(C)(C)C)nc3cc(S(=O)(=O)C4CN(C(N)=O)C4)ccc32)CC1 |
| Molecular Formula | C24N5O4S1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 129.172 |
| HBA | 5 |
| HBD | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| LogP | 2.351 |
| Activity (Ki) in nM | 39.811 |
| Polar Surface Area (PSA) | 126.98 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.32567021 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 9 |
| Fraction csp3 | 0.62 |
| Ilogp | 2.47 |
| Xlogp3 | 1.64 |
| Wlogp | 2.74 |
| Mlogp | 2.01 |
| Silicos-it log p | 1.31 |
| Consensus log p | 2.03 |
| Esol log s | -3.58 |
| Esol solubility (mg/ml) | 1.30E-01 |
| Esol solubility (mol/l) | 2.65E-04 |
| Esol class | Soluble |
| Ali log s | -3.92 |
| Ali solubility (mg/ml) | 5.89E-02 |
| Ali solubility (mol/l) | 1.20E-04 |
| Ali class | Soluble |
| Silicos-it logsw | -4.22 |
| Silicos-it solubility (mg/ml) | 2.95E-02 |
| Silicos-it solubility (mol/l) | 6.03E-05 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -8.12 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 2 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.86 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -2.571 |
| Logd | 1.637 |
| Logp | 1.831 |
| F (20%) | 0.004 |
| F (30%) | 0.011 |
| Mdck | 1.42E-05 |
| Ppb | 0.6575 |
| Vdss | 1.188 |
| Fu | 0.4302 |
| Cyp1a2-inh | 0.013 |
| Cyp1a2-sub | 0.074 |
| Cyp2c19-inh | 0.218 |
| Cyp2c19-sub | 0.361 |
| Cl | 2.662 |
| T12 | 0.201 |
| H-ht | 0.978 |
| Dili | 0.979 |
| Roa | 0.925 |
| Fdamdd | 0.949 |
| Skinsen | 0.021 |
| Ec | 0.003 |
| Ei | 0.007 |
| Respiratory | 0.03 |
| Bcf | 0.085 |
| Igc50 | 2.044 |
| Lc50 | 2.414 |
| Lc50dm | 3.535 |
| Nr-ar | 0.501 |
| Nr-ar-lbd | 0.148 |
| Nr-ahr | 0.073 |
| Nr-aromatase | 0.005 |
| Nr-er | 0.334 |
| Nr-er-lbd | 0.251 |
| Nr-ppar-gamma | 0.03 |
| Sr-are | 0.673 |
| Sr-atad5 | 0.004 |
| Sr-hse | 0.065 |
| Sr-mmp | 0.243 |
| Sr-p53 | 0.012 |
| Vol | 482.269 |
| Dense | 1.014 |
| Flex | 24 |
| Nstereo | 0.333 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 0 |
| Qed | 3 |
| Synth | 0.692 |
| Fsp3 | 2.908 |
| Mce-18 | 0.625 |
| Natural product-likeness | 69.897 |
| Alarm nmr | -1.415 |
| Bms | 1 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Accepted |
| Goldentriangle | Rejected |