| General Information | |
|---|---|
| ZINC ID | ZINC000068246962 |
| Molecular Weight (Da) | 525 |
| SMILES | CCOc1ccc(Cc2nc3cc(N(C)S(=O)(=O)c4cccs4)ccc3n2CC2CCCCC2)nc1 |
| Molecular Formula | C27N4O3S2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 141.303 |
| HBA | 5 |
| HBD | 0 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| LogP | 5.798 |
| Activity (Ki) in nM | 0.562 |
| Polar Surface Area (PSA) | 113.94 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.948 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 20 |
| Fraction csp3 | 0.41 |
| Ilogp | 4.14 |
| Xlogp3 | 5.72 |
| Wlogp | 6.97 |
| Mlogp | 2.85 |
| Silicos-it log p | 4.91 |
| Consensus log p | 4.92 |
| Esol log s | -6.51 |
| Esol solubility (mg/ml) | 0.000161 |
| Esol solubility (mol/l) | 0.0000003 |
| Esol class | Poorly sol |
| Ali log s | -7.88 |
| Ali solubility (mg/ml) | 0.00000692 |
| Ali solubility (mol/l) | 1.32E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.24 |
| Silicos-it solubility (mg/ml) | 0.00000304 |
| Silicos-it solubility (mol/l) | 5.79E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.44 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 4 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.064 |
| Logd | 4.412 |
| Logp | 5.804 |
| F (20%) | 0.018 |
| F (30%) | 0.828 |
| Mdck | 1.69E-05 |
| Ppb | 0.9933 |
| Vdss | 0.885 |
| Fu | 0.0079 |
| Cyp1a2-inh | 0.208 |
| Cyp1a2-sub | 0.443 |
| Cyp2c19-inh | 0.908 |
| Cyp2c19-sub | 0.596 |
| Cl | 4.481 |
| T12 | 0.216 |
| H-ht | 0.894 |
| Dili | 0.983 |
| Roa | 0.256 |
| Fdamdd | 0.93 |
| Skinsen | 0.041 |
| Ec | 0.003 |
| Ei | 0.01 |
| Respiratory | 0.92 |
| Bcf | 1.608 |
| Igc50 | 4.921 |
| Lc50 | 6.157 |
| Lc50dm | 4.697 |
| Nr-ar | 0.001 |
| Nr-ar-lbd | 0.01 |
| Nr-ahr | 0.206 |
| Nr-aromatase | 0.401 |
| Nr-er | 0.594 |
| Nr-er-lbd | 0.058 |
| Nr-ppar-gamma | 0.964 |
| Sr-are | 0.891 |
| Sr-atad5 | 0.009 |
| Sr-hse | 0.412 |
| Sr-mmp | 0.929 |
| Sr-p53 | 0.752 |
| Vol | 516.413 |
| Dense | 1.015 |
| Flex | 0.31 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 3 |
| Qed | 0.273 |
| Synth | 2.777 |
| Fsp3 | 0.407 |
| Mce-18 | 64.842 |
| Natural product-likeness | -1.946 |
| Alarm nmr | 4 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Rejected |