| General Information | |
|---|---|
| ZINC ID | ZINC000071317570 |
| Molecular Weight (Da) | 495 |
| SMILES | COc1ccc(-c2c(C)c(C(=O)NC3(C#N)CCOCC3)nn2-c2ccccc2Br)cc1 |
| Molecular Formula | C24Br1N4O3 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 127.45 |
| HBA | 5 |
| HBD | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| LogP | 4.029 |
| Activity (Ki) in nM | 1905.461 |
| Polar Surface Area (PSA) | 89.17 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.062 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 17 |
| Fraction csp3 | 0.29 |
| Ilogp | 3.82 |
| Xlogp3 | 4.18 |
| Wlogp | 4.42 |
| Mlogp | 2.42 |
| Silicos-it log p | 4.38 |
| Consensus log p | 3.84 |
| Esol log s | -5.54 |
| Esol solubility (mg/ml) | 0.00142 |
| Esol solubility (mol/l) | 0.00000287 |
| Esol class | Moderately |
| Ali log s | -5.76 |
| Ali solubility (mg/ml) | 0.000858 |
| Ali solubility (mol/l) | 0.00000173 |
| Ali class | Moderately |
| Silicos-it logsw | -7.84 |
| Silicos-it solubility (mg/ml) | 0.00000713 |
| Silicos-it solubility (mol/l) | 1.44E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.35 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.45 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.48 |
| Logd | 3.275 |
| Logp | 3.5 |
| F (20%) | 0.016 |
| F (30%) | 0.033 |
| Mdck | 2.54E-05 |
| Ppb | 0.9588 |
| Vdss | 0.795 |
| Fu | 0.0443 |
| Cyp1a2-inh | 0.353 |
| Cyp1a2-sub | 0.269 |
| Cyp2c19-inh | 0.841 |
| Cyp2c19-sub | 0.09 |
| Cl | 3.148 |
| T12 | 0.143 |
| H-ht | 0.65 |
| Dili | 0.98 |
| Roa | 0.966 |
| Fdamdd | 0.571 |
| Skinsen | 0.112 |
| Ec | 0.003 |
| Ei | 0.013 |
| Respiratory | 0.652 |
| Bcf | 1.131 |
| Igc50 | 3.793 |
| Lc50 | 5.483 |
| Lc50dm | 5.354 |
| Nr-ar | 0.006 |
| Nr-ar-lbd | 0.025 |
| Nr-ahr | 0.861 |
| Nr-aromatase | 0.902 |
| Nr-er | 0.804 |
| Nr-er-lbd | 0.016 |
| Nr-ppar-gamma | 0.54 |
| Sr-are | 0.818 |
| Sr-atad5 | 0.507 |
| Sr-hse | 0.389 |
| Sr-mmp | 0.769 |
| Sr-p53 | 0.963 |
| Vol | 450.075 |
| Dense | 1.098 |
| Flex | 0.24 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 2 |
| Qed | 0.566 |
| Synth | 2.71 |
| Fsp3 | 0.292 |
| Mce-18 | 55.742 |
| Natural product-likeness | -1.209 |
| Alarm nmr | 2 |
| Bms | 1 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Accepted |