| General Information | |
|---|---|
| ZINC ID | ZINC000071329486 |
| Molecular Weight (Da) | 370 |
| SMILES | O=C(c1ccccc1)N1CC[C@](O)(c2ccc(Cl)cc2)[C@H]2CCCC[C@@H]21 |
| Molecular Formula | C22Cl1N1O2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 103.621 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| LogP | 4.215 |
| Activity (Ki) in nM | 154.882 |
| Polar Surface Area (PSA) | 40.54 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | - |
| Biodegradation | |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.92466837 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 12 |
| Fraction csp3 | 0.41 |
| Ilogp | 3.4 |
| Xlogp3 | 4.52 |
| Wlogp | 4.14 |
| Mlogp | 4.11 |
| Silicos-it log p | 4.22 |
| Consensus log p | 4.08 |
| Esol log s | -5.12 |
| Esol solubility (mg/ml) | 2.78E-03 |
| Esol solubility (mol/l) | 7.51E-06 |
| Esol class | Moderately |
| Ali log s | -5.09 |
| Ali solubility (mg/ml) | 2.99E-03 |
| Ali solubility (mol/l) | 8.07E-06 |
| Ali class | Moderately |
| Silicos-it logsw | -6.21 |
| Silicos-it solubility (mg/ml) | 2.28E-04 |
| Silicos-it solubility (mol/l) | 6.15E-07 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.35 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.24 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.124 |
| Logd | 3.895 |
| Logp | 4.257 |
| F (20%) | 0.021 |
| F (30%) | 0.004 |
| Mdck | 1.11E-05 |
| Ppb | 0.9686 |
| Vdss | 1.168 |
| Fu | 0.0146 |
| Cyp1a2-inh | 0.418 |
| Cyp1a2-sub | 0.688 |
| Cyp2c19-inh | 0.934 |
| Cyp2c19-sub | 0.245 |
| Cl | 2.183 |
| T12 | 0.077 |
| H-ht | 0.268 |
| Dili | 0.616 |
| Roa | 0.085 |
| Fdamdd | 0.161 |
| Skinsen | 0.876 |
| Ec | 0.003 |
| Ei | 0.153 |
| Respiratory | 0.612 |
| Bcf | 0.967 |
| Igc50 | 4.478 |
| Lc50 | 4.801 |
| Lc50dm | 4.643 |
| Nr-ar | 0.226 |
| Nr-ar-lbd | 0.031 |
| Nr-ahr | 0.131 |
| Nr-aromatase | 0.467 |
| Nr-er | 0.438 |
| Nr-er-lbd | 0.014 |
| Nr-ppar-gamma | 0.003 |
| Sr-are | 0.34 |
| Sr-atad5 | 0.017 |
| Sr-hse | 0.018 |
| Sr-mmp | 0.617 |
| Sr-p53 | 0.179 |
| Vol | 380.175 |
| Dense | 0.971 |
| Flex | 24 |
| Nstereo | 0.125 |
| Nongenotoxic carcinogenicity | 3 |
| Ld50 oral | 1 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 1 |
| Qed | 0 |
| Synth | 0.838 |
| Fsp3 | 3.091 |
| Mce-18 | 0.409 |
| Natural product-likeness | 78.774 |
| Alarm nmr | -0.242 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Rejected |