| General Information | |
|---|---|
| ZINC ID | ZINC000071329998 |
| Molecular Weight (Da) | 388 |
| SMILES | CC(C)(C)c1ccc(NC(=O)N2CCCN(C(=O)C3CCOCC3)CC2)cc1 |
| Molecular Formula | C22N3O3 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 112.392 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| LogP | 3.186 |
| Activity (Ki) in nM | 112.202 |
| Polar Surface Area (PSA) | 61.88 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.68653482 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.64 |
| Ilogp | 3.77 |
| Xlogp3 | 2.72 |
| Wlogp | 2.52 |
| Mlogp | 2.51 |
| Silicos-it log p | 2.62 |
| Consensus log p | 2.83 |
| Esol log s | -3.72 |
| Esol solubility (mg/ml) | 7.40E-02 |
| Esol solubility (mol/l) | 1.91E-04 |
| Esol class | Soluble |
| Ali log s | -3.67 |
| Ali solubility (mg/ml) | 8.22E-02 |
| Ali solubility (mol/l) | 2.12E-04 |
| Ali class | Soluble |
| Silicos-it logsw | -4.45 |
| Silicos-it solubility (mg/ml) | 1.38E-02 |
| Silicos-it solubility (mol/l) | 3.56E-05 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.73 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 3.17 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.283 |
| Logd | 2.969 |
| Logp | 3.016 |
| F (20%) | 0.01 |
| F (30%) | 0.084 |
| Mdck | 1.35E-05 |
| Ppb | 0.8697 |
| Vdss | 0.869 |
| Fu | 0.1259 |
| Cyp1a2-inh | 0.016 |
| Cyp1a2-sub | 0.122 |
| Cyp2c19-inh | 0.393 |
| Cyp2c19-sub | 0.868 |
| Cl | 4.954 |
| T12 | 0.413 |
| H-ht | 0.219 |
| Dili | 0.133 |
| Roa | 0.94 |
| Fdamdd | 0.087 |
| Skinsen | 0.522 |
| Ec | 0.003 |
| Ei | 0.03 |
| Respiratory | 0.023 |
| Bcf | 0.558 |
| Igc50 | 2.466 |
| Lc50 | 3.356 |
| Lc50dm | 4.373 |
| Nr-ar | 0.241 |
| Nr-ar-lbd | 0.011 |
| Nr-ahr | 0.58 |
| Nr-aromatase | 0.097 |
| Nr-er | 0.309 |
| Nr-er-lbd | 0.018 |
| Nr-ppar-gamma | 0.013 |
| Sr-are | 0.793 |
| Sr-atad5 | 0.004 |
| Sr-hse | 0.05 |
| Sr-mmp | 0.515 |
| Sr-p53 | 0.158 |
| Vol | 409.577 |
| Dense | 0.945 |
| Flex | 21 |
| Nstereo | 0.286 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 1 |
| Nonbiodegradable | 0 |
| Skin sensitization | 2 |
| Acute aquatic toxicity | 4 |
| Toxicophores | 0 |
| Qed | 1 |
| Synth | 0.845 |
| Fsp3 | 2.173 |
| Mce-18 | 0.636 |
| Natural product-likeness | 48.556 |
| Alarm nmr | -1.532 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 4 |
| Gsk | Rejected |
| Goldentriangle | Accepted |