| General Information | |
|---|---|
| ZINC ID | ZINC000071330094 |
| Molecular Weight (Da) | 364 |
| SMILES | CC(C)(C)c1cc(NC(=O)N2CCCN(C(=O)[C@H]3CCOC3)CC2)no1 |
| Molecular Formula | C18N4O4 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 96.736 |
| HBA | 5 |
| HBD | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| LogP | 2.107 |
| Activity (Ki) in nM | 2290.868 |
| Polar Surface Area (PSA) | 87.91 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.61256361 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 5 |
| Fraction csp3 | 0.72 |
| Ilogp | 2.97 |
| Xlogp3 | 1.18 |
| Wlogp | 1.12 |
| Mlogp | 0.88 |
| Silicos-it log p | 1.2 |
| Consensus log p | 1.47 |
| Esol log s | -2.59 |
| Esol solubility (mg/ml) | 9.38E-01 |
| Esol solubility (mol/l) | 2.57E-03 |
| Esol class | Soluble |
| Ali log s | -2.62 |
| Ali solubility (mg/ml) | 8.71E-01 |
| Ali solubility (mol/l) | 2.39E-03 |
| Ali class | Soluble |
| Silicos-it logsw | -3.03 |
| Silicos-it solubility (mg/ml) | 3.42E-01 |
| Silicos-it solubility (mol/l) | 9.38E-04 |
| Silicos-it class | Soluble |
| Pgp substrate | |
| Log kp (cm/s) | -7.69 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 4.16 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -2.251 |
| Logd | 1.651 |
| Logp | 1.607 |
| F (20%) | 0.074 |
| F (30%) | 0.039 |
| Mdck | 6.64E-06 |
| Ppb | 0.7175 |
| Vdss | 0.846 |
| Fu | 0.2811 |
| Cyp1a2-inh | 0.029 |
| Cyp1a2-sub | 0.228 |
| Cyp2c19-inh | 0.402 |
| Cyp2c19-sub | 0.807 |
| Cl | 4.247 |
| T12 | 0.818 |
| H-ht | 0.96 |
| Dili | 0.85 |
| Roa | 0.879 |
| Fdamdd | 0.355 |
| Skinsen | 0.392 |
| Ec | 0.003 |
| Ei | 0.013 |
| Respiratory | 0.212 |
| Bcf | 0.601 |
| Igc50 | 2.071 |
| Lc50 | 2.8 |
| Lc50dm | 3.876 |
| Nr-ar | 0.625 |
| Nr-ar-lbd | 0.005 |
| Nr-ahr | 0.227 |
| Nr-aromatase | 0.019 |
| Nr-er | 0.244 |
| Nr-er-lbd | 0.008 |
| Nr-ppar-gamma | 0.02 |
| Sr-are | 0.579 |
| Sr-atad5 | 0.006 |
| Sr-hse | 0.026 |
| Sr-mmp | 0.099 |
| Sr-p53 | 0.026 |
| Vol | 362.817 |
| Dense | 1.004 |
| Flex | 20 |
| Nstereo | 0.25 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 2 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 0 |
| Qed | 2 |
| Synth | 0.817 |
| Fsp3 | 3.753 |
| Mce-18 | 0.722 |
| Natural product-likeness | 68.032 |
| Alarm nmr | -0.633 |
| Bms | 2 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Accepted |
| Goldentriangle | Accepted |