| General Information | |
|---|---|
| ZINC ID | ZINC000071330987 |
| Molecular Weight (Da) | 406 |
| SMILES | COc1ccc(C)cc1Cn1c(C(=O)NCC(C)(C)CO)cc2cc(C#N)ccc21 |
| Molecular Formula | C24N3O3 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 114.799 |
| HBA | 4 |
| HBD | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| LogP | 4.045 |
| Activity (Ki) in nM | 0.7586 |
| Polar Surface Area (PSA) | 87.28 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.55 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 15 |
| Fraction csp3 | 0.33 |
| Ilogp | 3.7 |
| Xlogp3 | 3.77 |
| Wlogp | 3.63 |
| Mlogp | 1.86 |
| Silicos-it log p | 4.27 |
| Consensus log p | 3.45 |
| Esol log s | -4.57 |
| Esol solubility (mg/ml) | 0.0109 |
| Esol solubility (mol/l) | 0.0000268 |
| Esol class | Moderately |
| Ali log s | -5.3 |
| Ali solubility (mg/ml) | 0.00205 |
| Ali solubility (mol/l) | 0.00000506 |
| Ali class | Moderately |
| Silicos-it logsw | -6.96 |
| Silicos-it solubility (mg/ml) | 0.0000449 |
| Silicos-it solubility (mol/l) | 0.00000011 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.1 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.03 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.497 |
| Logd | 3.436 |
| Logp | 3.757 |
| F (20%) | 0.007 |
| F (30%) | 0.007 |
| Mdck | - |
| Ppb | 96.93% |
| Vdss | 0.476 |
| Fu | 2.92% |
| Cyp1a2-inh | 0.576 |
| Cyp1a2-sub | 0.703 |
| Cyp2c19-inh | 0.888 |
| Cyp2c19-sub | 0.251 |
| Cl | 8.745 |
| T12 | 0.256 |
| H-ht | 0.72 |
| Dili | 0.283 |
| Roa | 0.036 |
| Fdamdd | 0.942 |
| Skinsen | 0.063 |
| Ec | 0.003 |
| Ei | 0.012 |
| Respiratory | 0.143 |
| Bcf | 0.608 |
| Igc50 | 3.725 |
| Lc50 | 4.591 |
| Lc50dm | 4.413 |
| Nr-ar | 0.069 |
| Nr-ar-lbd | 0.005 |
| Nr-ahr | 0.794 |
| Nr-aromatase | 0.734 |
| Nr-er | 0.17 |
| Nr-er-lbd | 0.008 |
| Nr-ppar-gamma | 0.062 |
| Sr-are | 0.276 |
| Sr-atad5 | 0.018 |
| Sr-hse | 0.016 |
| Sr-mmp | 0.271 |
| Sr-p53 | 0.624 |
| Vol | 430.987 |
| Dense | 0.94 |
| Flex | 0.444 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 3 |
| Qed | 0.628 |
| Synth | 2.55 |
| Fsp3 | 0.333 |
| Mce-18 | 21 |
| Natural product-likeness | -1.384 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |