| General Information | |
|---|---|
| ZINC ID | ZINC000072109298 |
| Molecular Weight (Da) | 379 |
| SMILES | CC(C)(C)Cc1nc2cc(S(=O)(=O)C(C)(C)CO)ccc2n1CC1CC1 |
| Molecular Formula | C20N2O3S1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 102.734 |
| HBA | 4 |
| HBD | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| LogP | 3.737 |
| Activity (Ki) in nM | 1.202 |
| Polar Surface Area (PSA) | 80.57 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.44771665 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 9 |
| Fraction csp3 | 0.65 |
| Ilogp | 3.07 |
| Xlogp3 | 3.31 |
| Wlogp | 4.6 |
| Mlogp | 2.85 |
| Silicos-it log p | 3.46 |
| Consensus log p | 3.46 |
| Esol log s | -4.07 |
| Esol solubility (mg/ml) | 3.25E-02 |
| Esol solubility (mol/l) | 8.58E-05 |
| Esol class | Moderately |
| Ali log s | -4.68 |
| Ali solubility (mg/ml) | 7.95E-03 |
| Ali solubility (mol/l) | 2.10E-05 |
| Ali class | Moderately |
| Silicos-it logsw | -5.22 |
| Silicos-it solubility (mg/ml) | 2.27E-03 |
| Silicos-it solubility (mol/l) | 5.98E-06 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.26 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 3.36 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.192 |
| Logd | 3.176 |
| Logp | 3.496 |
| F (20%) | 0.219 |
| F (30%) | 0.001 |
| Mdck | 2.03E-05 |
| Ppb | 0.8629 |
| Vdss | 1.211 |
| Fu | 0.2196 |
| Cyp1a2-inh | 0.12 |
| Cyp1a2-sub | 0.103 |
| Cyp2c19-inh | 0.753 |
| Cyp2c19-sub | 0.584 |
| Cl | 7.099 |
| T12 | 0.198 |
| H-ht | 0.772 |
| Dili | 0.948 |
| Roa | 0.133 |
| Fdamdd | 0.85 |
| Skinsen | 0.039 |
| Ec | 0.003 |
| Ei | 0.012 |
| Respiratory | 0.33 |
| Bcf | 0.934 |
| Igc50 | 3.693 |
| Lc50 | 4.08 |
| Lc50dm | 3.819 |
| Nr-ar | 0.002 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.258 |
| Nr-aromatase | 0.794 |
| Nr-er | 0.209 |
| Nr-er-lbd | 0.011 |
| Nr-ppar-gamma | 0.012 |
| Sr-are | 0.653 |
| Sr-atad5 | 0.001 |
| Sr-hse | 0.338 |
| Sr-mmp | 0.719 |
| Sr-p53 | 0.055 |
| Vol | 385.134 |
| Dense | 0.982 |
| Flex | 15 |
| Nstereo | 0.467 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 0 |
| Qed | 3 |
| Synth | 0.834 |
| Fsp3 | 2.824 |
| Mce-18 | 0.65 |
| Natural product-likeness | 52.364 |
| Alarm nmr | -1.062 |
| Bms | 1 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Accepted |