| General Information | |
|---|---|
| ZINC ID | ZINC000072110884 |
| Molecular Weight (Da) | 492 |
| SMILES | Cc1cncc(C(=O)NC2(C(=O)N[C@H](C)c3ccc(-n4nc(Cl)c5ccccc54)cc3F)CC2)c1 |
| Molecular Formula | C26Cl1F1N5O2 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 132.503 |
| HBA | 4 |
| HBD | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| LogP | 4.128 |
| Activity (Ki) in nM | 0.4677 |
| Polar Surface Area (PSA) | 88.91 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.009 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 21 |
| Fraction csp3 | 0.23 |
| Ilogp | 3.32 |
| Xlogp3 | 4.45 |
| Wlogp | 4.69 |
| Mlogp | 3.59 |
| Silicos-it log p | 4.83 |
| Consensus log p | 4.18 |
| Esol log s | -5.61 |
| Esol solubility (mg/ml) | 0.00121 |
| Esol solubility (mol/l) | 0.00000246 |
| Esol class | Moderately |
| Ali log s | -6.04 |
| Ali solubility (mg/ml) | 0.000453 |
| Ali solubility (mol/l) | 0.00000092 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.12 |
| Silicos-it solubility (mg/ml) | 0.00000037 |
| Silicos-it solubility (mol/l) | 7.66E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.14 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 2 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.56 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.782 |
| Logd | 3.688 |
| Logp | 4.107 |
| F (20%) | 0.001 |
| F (30%) | 0.002 |
| Mdck | - |
| Ppb | 95.70% |
| Vdss | 1.87 |
| Fu | 2.19% |
| Cyp1a2-inh | 0.29 |
| Cyp1a2-sub | 0.397 |
| Cyp2c19-inh | 0.804 |
| Cyp2c19-sub | 0.619 |
| Cl | 2.202 |
| T12 | 0.092 |
| H-ht | 0.869 |
| Dili | 0.97 |
| Roa | 0.517 |
| Fdamdd | 0.954 |
| Skinsen | 0.209 |
| Ec | 0.003 |
| Ei | 0.007 |
| Respiratory | 0.434 |
| Bcf | 0.586 |
| Igc50 | 3.519 |
| Lc50 | 5.024 |
| Lc50dm | 5.528 |
| Nr-ar | 0.041 |
| Nr-ar-lbd | 0.004 |
| Nr-ahr | 0.882 |
| Nr-aromatase | 0.786 |
| Nr-er | 0.462 |
| Nr-er-lbd | 0.005 |
| Nr-ppar-gamma | 0.249 |
| Sr-are | 0.829 |
| Sr-atad5 | 0.525 |
| Sr-hse | 0.055 |
| Sr-mmp | 0.665 |
| Sr-p53 | 0.908 |
| Vol | 477.675 |
| Dense | 1.028 |
| Flex | 0.296 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | - |
| Toxicophores | 2 |
| Qed | 0.41 |
| Synth | 3.228 |
| Fsp3 | 0.231 |
| Mce-18 | 95.625 |
| Natural product-likeness | -1.555 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |