| General Information | |
|---|---|
| ZINC ID | ZINC000072123568 |
| Molecular Weight (Da) | 441 |
| SMILES | CC(C)CN1C(=O)CN(Cc2ccc(-c3ccc(F)c(CN4CCOCC4)n3)cc2)C1=O |
| Molecular Formula | C24F1N4O3 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 119.663 |
| HBA | 4 |
| HBD | 0 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| LogP | 3.53 |
| Activity (Ki) in nM | 7.943 |
| Polar Surface Area (PSA) | 65.98 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.8440299 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 12 |
| Fraction csp3 | 0.46 |
| Ilogp | 4.17 |
| Xlogp3 | 2.34 |
| Wlogp | 2.11 |
| Mlogp | 1.59 |
| Silicos-it log p | 3.7 |
| Consensus log p | 2.78 |
| Esol log s | -3.86 |
| Esol solubility (mg/ml) | 6.07E-02 |
| Esol solubility (mol/l) | 1.38E-04 |
| Esol class | Soluble |
| Ali log s | -3.36 |
| Ali solubility (mg/ml) | 1.90E-01 |
| Ali solubility (mol/l) | 4.32E-04 |
| Ali class | Soluble |
| Silicos-it logsw | -6.21 |
| Silicos-it solubility (mg/ml) | 2.72E-04 |
| Silicos-it solubility (mol/l) | 6.18E-07 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -7.33 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 1 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 3.43 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -3.42 |
| Logd | 3.604 |
| Logp | 3.615 |
| F (20%) | 0.015 |
| F (30%) | 0.018 |
| Mdck | 2.14E-05 |
| Ppb | 0.8802 |
| Vdss | 1.525 |
| Fu | 0.1081 |
| Cyp1a2-inh | 0.129 |
| Cyp1a2-sub | 0.122 |
| Cyp2c19-inh | 0.891 |
| Cyp2c19-sub | 0.067 |
| Cl | 6.385 |
| T12 | 0.654 |
| H-ht | 0.957 |
| Dili | 0.665 |
| Roa | 0.15 |
| Fdamdd | 0.372 |
| Skinsen | 0.082 |
| Ec | 0.003 |
| Ei | 0.008 |
| Respiratory | 0.344 |
| Bcf | 1.268 |
| Igc50 | 3.55 |
| Lc50 | 4.61 |
| Lc50dm | 6.211 |
| Nr-ar | 0.007 |
| Nr-ar-lbd | 0.004 |
| Nr-ahr | 0.119 |
| Nr-aromatase | 0.133 |
| Nr-er | 0.213 |
| Nr-er-lbd | 0.045 |
| Nr-ppar-gamma | 0.003 |
| Sr-are | 0.702 |
| Sr-atad5 | 0.016 |
| Sr-hse | 0.018 |
| Sr-mmp | 0.085 |
| Sr-p53 | 0.02 |
| Vol | 444.768 |
| Dense | 0.99 |
| Flex | 24 |
| Nstereo | 0.292 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 4 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 1 |
| Qed | 1 |
| Synth | 0.611 |
| Fsp3 | 2.717 |
| Mce-18 | 0.417 |
| Natural product-likeness | 51.412 |
| Alarm nmr | -1.458 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Rejected |