| General Information | |
|---|---|
| ZINC ID | ZINC000072124709 |
| Molecular Weight (Da) | 457 |
| SMILES | CC(C)CN1C(=O)CN(Cc2ccc(-c3cccc(CN4CCCC(F)(F)C4)n3)cc2)C1=O |
| Molecular Formula | C25F2N4O2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 122.691 |
| HBA | 3 |
| HBD | 0 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| LogP | 4.33 |
| Activity (Ki) in nM | 1.995 |
| Polar Surface Area (PSA) | 56.75 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.9685179 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 12 |
| Fraction csp3 | 0.48 |
| Ilogp | 4.17 |
| Xlogp3 | 3.77 |
| Wlogp | 3.79 |
| Mlogp | 2.43 |
| Silicos-it log p | 4.33 |
| Consensus log p | 3.7 |
| Esol log s | -4.85 |
| Esol solubility (mg/ml) | 6.41E-03 |
| Esol solubility (mol/l) | 1.40E-05 |
| Esol class | Moderately |
| Ali log s | -4.66 |
| Ali solubility (mg/ml) | 1.01E-02 |
| Ali solubility (mol/l) | 2.21E-05 |
| Ali class | Moderately |
| Silicos-it logsw | -7 |
| Silicos-it solubility (mg/ml) | 4.57E-05 |
| Silicos-it solubility (mol/l) | 1.00E-07 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.41 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 1 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.39 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4 |
| Logd | 4.026 |
| Logp | 4.24 |
| F (20%) | 0.035 |
| F (30%) | 0.6 |
| Mdck | 1.23E-05 |
| Ppb | 0.9108 |
| Vdss | 2.381 |
| Fu | 0.0703 |
| Cyp1a2-inh | 0.248 |
| Cyp1a2-sub | 0.551 |
| Cyp2c19-inh | 0.737 |
| Cyp2c19-sub | 0.074 |
| Cl | 6.22 |
| T12 | 0.382 |
| H-ht | 0.896 |
| Dili | 0.359 |
| Roa | 0.235 |
| Fdamdd | 0.911 |
| Skinsen | 0.187 |
| Ec | 0.003 |
| Ei | 0.009 |
| Respiratory | 0.564 |
| Bcf | 1.433 |
| Igc50 | 4.45 |
| Lc50 | 5.584 |
| Lc50dm | 5.899 |
| Nr-ar | 0.016 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.055 |
| Nr-aromatase | 0.41 |
| Nr-er | 0.216 |
| Nr-er-lbd | 0.027 |
| Nr-ppar-gamma | 0.004 |
| Sr-are | 0.549 |
| Sr-atad5 | 0.012 |
| Sr-hse | 0.649 |
| Sr-mmp | 0.387 |
| Sr-p53 | 0.046 |
| Vol | 459.341 |
| Dense | 0.993 |
| Flex | 24 |
| Nstereo | 0.292 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 1 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 2 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 1 |
| Qed | 1 |
| Synth | 0.574 |
| Fsp3 | 2.864 |
| Mce-18 | 0.44 |
| Natural product-likeness | 56.944 |
| Alarm nmr | -1.114 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Rejected |