| General Information | |
|---|---|
| ZINC ID | ZINC000072125098 |
| Molecular Weight (Da) | 407 |
| SMILES | CC(C)N1C(=O)CN(Cc2ccc(-c3cccc(CN4CCCCC4)n3)cc2)C1=O |
| Molecular Formula | C24N4O2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 117.935 |
| HBA | 3 |
| HBD | 0 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| LogP | 4.088 |
| Activity (Ki) in nM | 12.589 |
| Polar Surface Area (PSA) | 56.75 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.71508193 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 12 |
| Fraction csp3 | 0.46 |
| Ilogp | 4.18 |
| Xlogp3 | 2.92 |
| Wlogp | 2.46 |
| Mlogp | 2.02 |
| Silicos-it log p | 3.52 |
| Consensus log p | 3.02 |
| Esol log s | -4.1 |
| Esol solubility (mg/ml) | 3.23E-02 |
| Esol solubility (mol/l) | 7.94E-05 |
| Esol class | Moderately |
| Ali log s | -3.77 |
| Ali solubility (mg/ml) | 6.86E-02 |
| Ali solubility (mol/l) | 1.69E-04 |
| Ali class | Soluble |
| Silicos-it logsw | -6.09 |
| Silicos-it solubility (mg/ml) | 3.27E-04 |
| Silicos-it solubility (mol/l) | 8.04E-07 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.71 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 1 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 3.13 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -3.039 |
| Logd | 3.631 |
| Logp | 3.934 |
| F (20%) | 0.026 |
| F (30%) | 0.051 |
| Mdck | 1.41E-05 |
| Ppb | 0.8028 |
| Vdss | 1.976 |
| Fu | 0.1667 |
| Cyp1a2-inh | 0.252 |
| Cyp1a2-sub | 0.382 |
| Cyp2c19-inh | 0.545 |
| Cyp2c19-sub | 0.098 |
| Cl | 7.558 |
| T12 | 0.596 |
| H-ht | 0.802 |
| Dili | 0.193 |
| Roa | 0.056 |
| Fdamdd | 0.53 |
| Skinsen | 0.199 |
| Ec | 0.003 |
| Ei | 0.01 |
| Respiratory | 0.598 |
| Bcf | 1.173 |
| Igc50 | 4.377 |
| Lc50 | 5.013 |
| Lc50dm | 5.071 |
| Nr-ar | 0.009 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.14 |
| Nr-aromatase | 0.632 |
| Nr-er | 0.211 |
| Nr-er-lbd | 0.041 |
| Nr-ppar-gamma | 0.003 |
| Sr-are | 0.682 |
| Sr-atad5 | 0.013 |
| Sr-hse | 0.346 |
| Sr-mmp | 0.318 |
| Sr-p53 | 0.267 |
| Vol | 429.91 |
| Dense | 0.945 |
| Flex | 24 |
| Nstereo | 0.25 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 0 |
| Qed | 1 |
| Synth | 0.671 |
| Fsp3 | 2.546 |
| Mce-18 | 0.417 |
| Natural product-likeness | 50.471 |
| Alarm nmr | -1.341 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Rejected |