| General Information | |
|---|---|
| ZINC ID | ZINC000072180944 |
| Molecular Weight (Da) | 377 |
| SMILES | CCCCCCC(C)(C)c1cc(OC)c([C@@H]2CCC[C@@](C)(O)C2)c(OC)c1 |
| Molecular Formula | C24O3 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 113.153 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| LogP | 6.638 |
| Activity (Ki) in nM | 22.909 |
| Polar Surface Area (PSA) | 38.69 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | + |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.67099279 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.75 |
| Ilogp | 4.91 |
| Xlogp3 | 7.25 |
| Wlogp | 6.36 |
| Mlogp | 4.25 |
| Silicos-it log p | 6.58 |
| Consensus log p | 5.87 |
| Esol log s | -6.31 |
| Esol solubility (mg/ml) | 0.000183 |
| Esol solubility (mol/l) | 0.00000048 |
| Esol class | Poorly sol |
| Ali log s | -7.89 |
| Ali solubility (mg/ml) | 0.00000488 |
| Ali solubility (mol/l) | 0.00000001 |
| Ali class | Poorly sol |
| Silicos-it logsw | -7.07 |
| Silicos-it solubility (mg/ml) | 0.0000324 |
| Silicos-it solubility (mol/l) | 8.61E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -3.45 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 4.04 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.994 |
| Logd | 5.132 |
| Logp | 7.251 |
| F (20%) | 0.983 |
| F (30%) | 0.922 |
| Mdck | 1.08E-05 |
| Ppb | 0.9862 |
| Vdss | 3.206 |
| Fu | 0.0207 |
| Cyp1a2-inh | 0.129 |
| Cyp1a2-sub | 0.951 |
| Cyp2c19-inh | 0.525 |
| Cyp2c19-sub | 0.936 |
| Cl | 6.105 |
| T12 | 0.099 |
| H-ht | 0.046 |
| Dili | 0.42 |
| Roa | 0.123 |
| Fdamdd | 0.9 |
| Skinsen | 0.896 |
| Ec | 0.045 |
| Ei | 0.921 |
| Respiratory | 0.481 |
| Bcf | 2.203 |
| Igc50 | 5.317 |
| Lc50 | 6.504 |
| Lc50dm | 6.178 |
| Nr-ar | 0.689 |
| Nr-ar-lbd | 0.006 |
| Nr-ahr | 0.077 |
| Nr-aromatase | 0.666 |
| Nr-er | 0.061 |
| Nr-er-lbd | 0.007 |
| Nr-ppar-gamma | 0.033 |
| Sr-are | 0.325 |
| Sr-atad5 | 0.009 |
| Sr-hse | 0.019 |
| Sr-mmp | 0.446 |
| Sr-p53 | 0.151 |
| Vol | 425.008 |
| Dense | 0.885 |
| Flex | 0.75 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 2 |
| Toxicophores | 0 |
| Qed | 0.51 |
| Synth | 3.404 |
| Fsp3 | 0.75 |
| Mce-18 | 55.857 |
| Natural product-likeness | 0.86 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 2 |
| Gsk | Rejected |
| Goldentriangle | Rejected |