| General Information | |
|---|---|
| ZINC ID | ZINC000073129701 |
| Molecular Weight (Da) | 508 |
| SMILES | CCc1c(C(=O)NCc2ccc(Cl)c(Cl)c2)nn(-c2ccc(Cl)c(Cl)c2)c1-n1cccc1 |
| Molecular Formula | C23Cl4N4O1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 128.916 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| LogP | 7.104 |
| Activity (Ki) in nM | 29.512 |
| Polar Surface Area (PSA) | 51.85 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | - |
| Androgen receptor binding | - |
| Plasma protein binding | 0.78373897 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 22 |
| Fraction csp3 | 0.13 |
| Ilogp | 4.73 |
| Xlogp3 | 7.04 |
| Wlogp | 6.62 |
| Mlogp | 5.44 |
| Silicos-it log p | 5.98 |
| Consensus log p | 5.96 |
| Esol log s | -7.47 |
| Esol solubility (mg/ml) | 0.0000171 |
| Esol solubility (mol/l) | 3.37E-08 |
| Esol class | Poorly sol |
| Ali log s | -7.95 |
| Ali solubility (mg/ml) | 0.00000576 |
| Ali solubility (mol/l) | 1.13E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.82 |
| Silicos-it solubility (mg/ml) | 7.71E-08 |
| Silicos-it solubility (mol/l) | 1.52E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.4 |
| Lipinski number of violations | 2 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.17 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.24 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.295 |
| Logd | 4.176 |
| Logp | 6.369 |
| F (20%) | 0.001 |
| F (30%) | 0.008 |
| Mdck | 1.45E-05 |
| Ppb | 1.003 |
| Vdss | 0.95 |
| Fu | 0.0156 |
| Cyp1a2-inh | 0.817 |
| Cyp1a2-sub | 0.475 |
| Cyp2c19-inh | 0.925 |
| Cyp2c19-sub | 0.102 |
| Cl | 2.388 |
| T12 | 0.084 |
| H-ht | 0.28 |
| Dili | 0.962 |
| Roa | 0.496 |
| Fdamdd | 0.784 |
| Skinsen | 0.112 |
| Ec | 0.003 |
| Ei | 0.007 |
| Respiratory | 0.029 |
| Bcf | 2.829 |
| Igc50 | 5.001 |
| Lc50 | 6.035 |
| Lc50dm | 5.266 |
| Nr-ar | 0.045 |
| Nr-ar-lbd | 0.034 |
| Nr-ahr | 0.841 |
| Nr-aromatase | 0.973 |
| Nr-er | 0.61 |
| Nr-er-lbd | 0.27 |
| Nr-ppar-gamma | 0.835 |
| Sr-are | 0.914 |
| Sr-atad5 | 0.298 |
| Sr-hse | 0.485 |
| Sr-mmp | 0.946 |
| Sr-p53 | 0.93 |
| Vol | 456.759 |
| Dense | 1.108 |
| Flex | 0.304 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 2 |
| Qed | 0.313 |
| Synth | 2.56 |
| Fsp3 | 0.13 |
| Mce-18 | 24 |
| Natural product-likeness | -1.806 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Rejected |