| General Information | |
|---|---|
| ZINC ID | ZINC000073138934 |
| Molecular Weight (Da) | 459 |
| SMILES | CCc1c(C(=O)NC2CCCCC2)nn(-c2ccc(Cl)c(Cl)c2)c1-n1c(C)ccc1C |
| Molecular Formula | C24Cl2N4O1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 125.507 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| LogP | 6.616 |
| Activity (Ki) in nM | 1.698 |
| Polar Surface Area (PSA) | 51.85 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.107 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 16 |
| Fraction csp3 | 0.42 |
| Ilogp | 4.74 |
| Xlogp3 | 6.9 |
| Wlogp | 6.21 |
| Mlogp | 4.92 |
| Silicos-it log p | 5.45 |
| Consensus log p | 5.64 |
| Esol log s | -7.02 |
| Esol solubility (mg/ml) | 0.0000437 |
| Esol solubility (mol/l) | 9.52E-08 |
| Esol class | Poorly sol |
| Ali log s | -7.8 |
| Ali solubility (mg/ml) | 0.00000728 |
| Ali solubility (mol/l) | 1.58E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -7.93 |
| Silicos-it solubility (mg/ml) | 0.0000054 |
| Silicos-it solubility (mol/l) | 1.17E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.2 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.61 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.438 |
| Logd | 4.053 |
| Logp | 6.099 |
| F (20%) | 0.002 |
| F (30%) | 0.002 |
| Mdck | 1.27E-05 |
| Ppb | 0.9827 |
| Vdss | 1.397 |
| Fu | 0.0243 |
| Cyp1a2-inh | 0.371 |
| Cyp1a2-sub | 0.93 |
| Cyp2c19-inh | 0.898 |
| Cyp2c19-sub | 0.724 |
| Cl | 3.978 |
| T12 | 0.121 |
| H-ht | 0.612 |
| Dili | 0.924 |
| Roa | 0.91 |
| Fdamdd | 0.928 |
| Skinsen | 0.119 |
| Ec | 0.003 |
| Ei | 0.009 |
| Respiratory | 0.852 |
| Bcf | 1.916 |
| Igc50 | 4.869 |
| Lc50 | 5.81 |
| Lc50dm | 5.356 |
| Nr-ar | 0.131 |
| Nr-ar-lbd | 0.008 |
| Nr-ahr | 0.415 |
| Nr-aromatase | 0.945 |
| Nr-er | 0.645 |
| Nr-er-lbd | 0.127 |
| Nr-ppar-gamma | 0.731 |
| Sr-are | 0.825 |
| Sr-atad5 | 0.161 |
| Sr-hse | 0.211 |
| Sr-mmp | 0.883 |
| Sr-p53 | 0.921 |
| Vol | 451.542 |
| Dense | 1.015 |
| Flex | 0.261 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 2 |
| Qed | 0.493 |
| Synth | 2.644 |
| Fsp3 | 0.417 |
| Mce-18 | 56.471 |
| Natural product-likeness | -1.674 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Accepted |