| General Information | |
|---|---|
| ZINC ID | ZINC000073164791 |
| Molecular Weight (Da) | 467 |
| SMILES | CCCCCCC(C)(C)c1cc(O)cc(OCCCCCCCCCCOC(CO)CO)c1 |
| Molecular Formula | C28O5 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 136.3 |
| HBA | 5 |
| HBD | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 33 |
| LogP | 7.426 |
| Activity (Ki) in nM | 380.189 |
| Polar Surface Area (PSA) | 79.15 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | - |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | + |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 0.821 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.79 |
| Ilogp | 4.99 |
| Xlogp3 | 8.06 |
| Wlogp | 6.51 |
| Mlogp | 3.77 |
| Silicos-it log p | 7.78 |
| Consensus log p | 6.22 |
| Esol log s | -6.56 |
| Esol solubility (mg/ml) | 0.000129 |
| Esol solubility (mol/l) | 0.00000027 |
| Esol class | Poorly sol |
| Ali log s | -9.58 |
| Ali solubility (mg/ml) | 0.00000012 |
| Ali solubility (mol/l) | 2.65E-10 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.15 |
| Silicos-it solubility (mg/ml) | 0.0000033 |
| Silicos-it solubility (mol/l) | 7.06E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -3.42 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 3 |
| Veber number of violations | 1 |
| Egan number of violations | 1 |
| Muegge number of violations | 2 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 4.23 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.193 |
| Logd | 4.426 |
| Logp | 7.694 |
| F (20%) | 0.995 |
| F (30%) | 0.95 |
| Mdck | 1.61E-05 |
| Ppb | 0.9855 |
| Vdss | 1.504 |
| Fu | 0.0164 |
| Cyp1a2-inh | 0.129 |
| Cyp1a2-sub | 0.19 |
| Cyp2c19-inh | 0.357 |
| Cyp2c19-sub | 0.058 |
| Cl | 7.126 |
| T12 | 0.202 |
| H-ht | 0.034 |
| Dili | 0.014 |
| Roa | 0.037 |
| Fdamdd | 0.025 |
| Skinsen | 0.957 |
| Ec | 0.004 |
| Ei | 0.521 |
| Respiratory | 0.156 |
| Bcf | 1.453 |
| Igc50 | 5.616 |
| Lc50 | 5.23 |
| Lc50dm | 5.019 |
| Nr-ar | 0.008 |
| Nr-ar-lbd | 0.004 |
| Nr-ahr | 0.034 |
| Nr-aromatase | 0.664 |
| Nr-er | 0.693 |
| Nr-er-lbd | 0.041 |
| Nr-ppar-gamma | 0.092 |
| Sr-are | 0.642 |
| Sr-atad5 | 0.004 |
| Sr-hse | 0.849 |
| Sr-mmp | 0.975 |
| Sr-p53 | 0.157 |
| Vol | 520.329 |
| Dense | 0.896 |
| Flex | 3.5 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 2 |
| Toxicophores | 1 |
| Qed | 0.18 |
| Synth | 2.703 |
| Fsp3 | 0.786 |
| Mce-18 | 10 |
| Natural product-likeness | 0.518 |
| Alarm nmr | 1 |
| Bms | 1 |
| Chelating | 0 |
| Pfizer | 2 |
| Gsk | Rejected |
| Goldentriangle | Accepted |