| General Information | |
|---|---|
| ZINC ID | ZINC000084596623 |
| Molecular Weight (Da) | 591 |
| SMILES | CC(C)(NC(=O)c1cc2c(n(CC3CCCCC3)c1=O)CCCCCC2)C(=O)N1CCC(/C(O)=N/S(C)(=O)=O)CC1 |
| Molecular Formula | C30N4O6S1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 157.641 |
| HBA | 7 |
| HBD | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| LogP | 4.329 |
| Activity (Ki) in nM | 218.776 |
| Polar Surface Area (PSA) | 146.52 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | - |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | - |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.49256715 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.73 |
| Ilogp | 3.82 |
| Xlogp3 | 4.62 |
| Wlogp | 4.45 |
| Mlogp | 2.71 |
| Silicos-it log p | 3.47 |
| Consensus log p | 3.82 |
| Esol log s | -5.93 |
| Esol solubility (mg/ml) | 0.000698 |
| Esol solubility (mol/l) | 0.00000118 |
| Esol class | Moderately |
| Ali log s | -7.42 |
| Ali solubility (mg/ml) | 0.0000223 |
| Ali solubility (mol/l) | 3.78E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -5.42 |
| Silicos-it solubility (mg/ml) | 0.00224 |
| Silicos-it solubility (mol/l) | 0.00000378 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.62 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 3 |
| Veber number of violations | 1 |
| Egan number of violations | 1 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 2 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 4.72 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.751 |
| Logd | 1.286 |
| Logp | 3.295 |
| F (20%) | 0.999 |
| F (30%) | 0.995 |
| Mdck | - |
| Ppb | 94.23% |
| Vdss | 0.405 |
| Fu | 2.02% |
| Cyp1a2-inh | 0.014 |
| Cyp1a2-sub | 0.546 |
| Cyp2c19-inh | 0.279 |
| Cyp2c19-sub | 0.812 |
| Cl | 1.917 |
| T12 | 0.095 |
| H-ht | 0.956 |
| Dili | 0.664 |
| Roa | 0.972 |
| Fdamdd | 0.931 |
| Skinsen | 0.102 |
| Ec | 0.003 |
| Ei | 0.005 |
| Respiratory | 0.028 |
| Bcf | 0.605 |
| Igc50 | 3.661 |
| Lc50 | 3.691 |
| Lc50dm | 4.816 |
| Nr-ar | 0.39 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.051 |
| Nr-aromatase | 0.002 |
| Nr-er | 0.102 |
| Nr-er-lbd | 0.012 |
| Nr-ppar-gamma | 0.049 |
| Sr-are | 0.421 |
| Sr-atad5 | 0.003 |
| Sr-hse | 0.009 |
| Sr-mmp | 0.101 |
| Sr-p53 | 0.008 |
| Vol | 592.629 |
| Dense | 0.996 |
| Flex | 0.323 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | - |
| Toxicophores | 0 |
| Qed | 0.502 |
| Synth | 3.007 |
| Fsp3 | 0.733 |
| Mce-18 | 76.962 |
| Natural product-likeness | -1.215 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |