| General Information | |
|---|---|
| ZINC ID | ZINC000084596807 |
| Molecular Weight (Da) | 458 |
| SMILES | CCN1CCC[C@H]1Cn1c2c(cc(C(=O)NC3(C(=O)O)CCCCC3)c1=O)CCCCCC2 |
| Molecular Formula | C26N3O4 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 127.842 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| LogP | 4.872 |
| Activity (Ki) in nM | 2137.962 |
| Polar Surface Area (PSA) | 91.64 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | - |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | - |
| Biodegradation | |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.65053188 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.73 |
| Ilogp | 4 |
| Xlogp3 | 1.59 |
| Wlogp | 3.13 |
| Mlogp | 2.87 |
| Silicos-it log p | 3.73 |
| Consensus log p | 3.06 |
| Esol log s | -3.35 |
| Esol solubility (mg/ml) | 2.04E-01 |
| Esol solubility (mol/l) | 4.45E-04 |
| Esol class | Soluble |
| Ali log s | -3.13 |
| Ali solubility (mg/ml) | 3.43E-01 |
| Ali solubility (mol/l) | 7.49E-04 |
| Ali class | Soluble |
| Silicos-it logsw | -5.08 |
| Silicos-it solubility (mg/ml) | 3.78E-03 |
| Silicos-it solubility (mol/l) | 8.26E-06 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -7.96 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 2 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 4.43 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -3.812 |
| Logd | 2.761 |
| Logp | 3.517 |
| F (20%) | 0.993 |
| F (30%) | 0.979 |
| Mdck | 1.93E-05 |
| Ppb | 0.6673 |
| Vdss | 0.74 |
| Fu | 0.2187 |
| Cyp1a2-inh | 0.087 |
| Cyp1a2-sub | 0.814 |
| Cyp2c19-inh | 0.144 |
| Cyp2c19-sub | 0.532 |
| Cl | 1.739 |
| T12 | 0.191 |
| H-ht | 0.907 |
| Dili | 0.301 |
| Roa | 0.311 |
| Fdamdd | 0.895 |
| Skinsen | 0.302 |
| Ec | 0.003 |
| Ei | 0.011 |
| Respiratory | 0.543 |
| Bcf | 0.804 |
| Igc50 | 4.189 |
| Lc50 | 4.005 |
| Lc50dm | 4.17 |
| Nr-ar | 0.046 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.394 |
| Nr-aromatase | 0.019 |
| Nr-er | 0.252 |
| Nr-er-lbd | 0.011 |
| Nr-ppar-gamma | 0.256 |
| Sr-are | 0.442 |
| Sr-atad5 | 0.007 |
| Sr-hse | 0.02 |
| Sr-mmp | 0.149 |
| Sr-p53 | 0.238 |
| Vol | 478.995 |
| Dense | 0.955 |
| Flex | 27 |
| Nstereo | 0.259 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 0 |
| Qed | 0 |
| Synth | 0.682 |
| Fsp3 | 3.274 |
| Mce-18 | 0.731 |
| Natural product-likeness | 89.067 |
| Alarm nmr | -0.777 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Accepted |
| Goldentriangle | Rejected |