| General Information | |
|---|---|
| ZINC ID | ZINC000084596808 |
| Molecular Weight (Da) | 455 |
| SMILES | O=C(NC1(C(=O)O)CCCCC1)c1cc2c(n(Cc3ccc(F)cc3)c1=O)CCCCCC2 |
| Molecular Formula | C26F1N2O4 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 122.694 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| LogP | 5.684 |
| Activity (Ki) in nM | 8.913 |
| Polar Surface Area (PSA) | 88.4 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | - |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | - |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.01345062 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 12 |
| Fraction csp3 | 0.5 |
| Ilogp | 3.59 |
| Xlogp3 | 4.5 |
| Wlogp | 4.63 |
| Mlogp | 3.81 |
| Silicos-it log p | 4.9 |
| Consensus log p | 4.29 |
| Esol log s | -5.37 |
| Esol solubility (mg/ml) | 0.00196 |
| Esol solubility (mol/l) | 0.0000043 |
| Esol class | Moderately |
| Ali log s | -6.08 |
| Ali solubility (mg/ml) | 0.00038 |
| Ali solubility (mol/l) | 0.00000083 |
| Ali class | Poorly sol |
| Silicos-it logsw | -6.88 |
| Silicos-it solubility (mg/ml) | 0.0000606 |
| Silicos-it solubility (mol/l) | 0.00000013 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.88 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.56 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.62 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.297 |
| Logd | 3.505 |
| Logp | 4.777 |
| F (20%) | 0.48 |
| F (30%) | 0.322 |
| Mdck | 2.41E-05 |
| Ppb | 0.9696 |
| Vdss | 0.663 |
| Fu | 0.0082 |
| Cyp1a2-inh | 0.19 |
| Cyp1a2-sub | 0.152 |
| Cyp2c19-inh | 0.399 |
| Cyp2c19-sub | 0.1 |
| Cl | 1.211 |
| T12 | 0.127 |
| H-ht | 0.595 |
| Dili | 0.814 |
| Roa | 0.313 |
| Fdamdd | 0.917 |
| Skinsen | 0.179 |
| Ec | 0.003 |
| Ei | 0.012 |
| Respiratory | 0.077 |
| Bcf | 0.73 |
| Igc50 | 4.659 |
| Lc50 | 4.903 |
| Lc50dm | 5.195 |
| Nr-ar | 0.061 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.453 |
| Nr-aromatase | 0.062 |
| Nr-er | 0.25 |
| Nr-er-lbd | 0.007 |
| Nr-ppar-gamma | 0.706 |
| Sr-are | 0.514 |
| Sr-atad5 | 0.003 |
| Sr-hse | 0.028 |
| Sr-mmp | 0.345 |
| Sr-p53 | 0.247 |
| Vol | 466.157 |
| Dense | 0.974 |
| Flex | 0.214 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 0 |
| Qed | 0.708 |
| Synth | 2.581 |
| Fsp3 | 0.5 |
| Mce-18 | 62.769 |
| Natural product-likeness | -1.016 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Accepted |