| General Information | |
|---|---|
| ZINC ID | ZINC000084596857 |
| Molecular Weight (Da) | 413 |
| SMILES | COc1cccc2c(-c3noc(CN(C)CC(N)=O)n3)cn(CC3CCOCC3)c12 |
| Molecular Formula | C21N5O4 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 109.916 |
| HBA | 6 |
| HBD | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| LogP | 0.893 |
| Activity (Ki) in nM | 2511.89 |
| Polar Surface Area (PSA) | 108.64 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.649 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 14 |
| Fraction csp3 | 0.48 |
| Ilogp | 3.21 |
| Xlogp3 | 1.2 |
| Wlogp | 1.89 |
| Mlogp | 0.59 |
| Silicos-it log p | 1.84 |
| Consensus log p | 1.75 |
| Esol log s | -2.98 |
| Esol solubility (mg/ml) | 0.436 |
| Esol solubility (mol/l) | 0.00105 |
| Esol class | Soluble |
| Ali log s | -3.08 |
| Ali solubility (mg/ml) | 0.346 |
| Ali solubility (mol/l) | 0.000836 |
| Ali class | Soluble |
| Silicos-it logsw | -4.91 |
| Silicos-it solubility (mg/ml) | 0.00511 |
| Silicos-it solubility (mol/l) | 0.0000124 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -7.97 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.62 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -1.555 |
| Logd | 1.957 |
| Logp | 0.757 |
| F (20%) | 0.005 |
| F (30%) | 0.026 |
| Mdck | - |
| Ppb | 90.34% |
| Vdss | 1.68 |
| Fu | 9.29% |
| Cyp1a2-inh | 0.48 |
| Cyp1a2-sub | 0.481 |
| Cyp2c19-inh | 0.831 |
| Cyp2c19-sub | 0.322 |
| Cl | 11.989 |
| T12 | 0.268 |
| H-ht | 0.898 |
| Dili | 0.959 |
| Roa | 0.153 |
| Fdamdd | 0.755 |
| Skinsen | 0.105 |
| Ec | 0.003 |
| Ei | 0.008 |
| Respiratory | 0.94 |
| Bcf | 1.254 |
| Igc50 | 2.303 |
| Lc50 | 2.621 |
| Lc50dm | 3.635 |
| Nr-ar | 0.016 |
| Nr-ar-lbd | 0.008 |
| Nr-ahr | 0.082 |
| Nr-aromatase | 0.003 |
| Nr-er | 0.161 |
| Nr-er-lbd | 0.017 |
| Nr-ppar-gamma | 0.009 |
| Sr-are | 0.471 |
| Sr-atad5 | 0.008 |
| Sr-hse | 0.016 |
| Sr-mmp | 0.055 |
| Sr-p53 | 0.028 |
| Vol | 409.236 |
| Dense | 1.01 |
| Flex | 0.364 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 2 |
| Qed | 0.602 |
| Synth | 2.785 |
| Fsp3 | 0.476 |
| Mce-18 | 51.097 |
| Natural product-likeness | -1.583 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |