| General Information | |
|---|---|
| ZINC ID | ZINC000084604278 |
| Molecular Weight (Da) | 451 |
| SMILES | O=C(O)c1ccc(CNC(=O)c2cc3c(n(CC4CCCCC4)c2=O)CCCCCC3)cc1 |
| Molecular Formula | C27N2O4 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 127.843 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| LogP | 5.888 |
| Activity (Ki) in nM | 912.011 |
| Polar Surface Area (PSA) | 88.4 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | - |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | - |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 0.81410324 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 12 |
| Fraction csp3 | 0.52 |
| Ilogp | 3.36 |
| Xlogp3 | 5.65 |
| Wlogp | 4.56 |
| Mlogp | 3.91 |
| Silicos-it log p | 4.9 |
| Consensus log p | 4.47 |
| Esol log s | -6 |
| Esol solubility (mg/ml) | 4.50E-04 |
| Esol solubility (mol/l) | 1.00E-06 |
| Esol class | Poorly sol |
| Ali log s | -7.27 |
| Ali solubility (mg/ml) | 2.42E-05 |
| Ali solubility (mol/l) | 5.36E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -6.79 |
| Silicos-it solubility (mg/ml) | 7.39E-05 |
| Silicos-it solubility (mol/l) | 1.64E-07 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.04 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.56 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.67 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -3.168 |
| Logd | 3.651 |
| Logp | 6.204 |
| F (20%) | 0.886 |
| F (30%) | 0.999 |
| Mdck | 2.48E-05 |
| Ppb | 0.9845 |
| Vdss | 0.479 |
| Fu | 0.0034 |
| Cyp1a2-inh | 0.226 |
| Cyp1a2-sub | 0.113 |
| Cyp2c19-inh | 0.483 |
| Cyp2c19-sub | 0.063 |
| Cl | 2.166 |
| T12 | 0.212 |
| H-ht | 0.941 |
| Dili | 0.879 |
| Roa | 0.738 |
| Fdamdd | 0.745 |
| Skinsen | 0.111 |
| Ec | 0.003 |
| Ei | 0.012 |
| Respiratory | 0.211 |
| Bcf | 0.682 |
| Igc50 | 4.874 |
| Lc50 | 3.876 |
| Lc50dm | 4.104 |
| Nr-ar | 0.191 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.302 |
| Nr-aromatase | 0.471 |
| Nr-er | 0.271 |
| Nr-er-lbd | 0.009 |
| Nr-ppar-gamma | 0.935 |
| Sr-are | 0.223 |
| Sr-atad5 | 0.006 |
| Sr-hse | 0.428 |
| Sr-mmp | 0.559 |
| Sr-p53 | 0.312 |
| Vol | 477.385 |
| Dense | 0.943 |
| Flex | 28 |
| Nstereo | 0.25 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 0 |
| Qed | 0 |
| Synth | 0.667 |
| Fsp3 | 2.404 |
| Mce-18 | 0.519 |
| Natural product-likeness | 56.878 |
| Alarm nmr | -0.903 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Accepted |
| Goldentriangle | Rejected |