| General Information | |
|---|---|
| ZINC ID | ZINC000084616545 |
| Molecular Weight (Da) | 417 |
| SMILES | CC(C)[C@H](NC(=O)c1cc2c(n(CC3CCCCC3)c1=O)CCCCCC2)C(=O)O |
| Molecular Formula | C24N2O4 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 116.046 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| LogP | 5.483 |
| Activity (Ki) in nM | 114.815 |
| Polar Surface Area (PSA) | 88.4 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | - |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | - |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | - |
| Androgen receptor binding | - |
| Plasma protein binding | 0.72648465 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.71 |
| Ilogp | 3.16 |
| Xlogp3 | 5.59 |
| Wlogp | 3.93 |
| Mlogp | 3.26 |
| Silicos-it log p | 4.16 |
| Consensus log p | 4.02 |
| Esol log s | -5.63 |
| Esol solubility (mg/ml) | 0.000976 |
| Esol solubility (mol/l) | 0.00000234 |
| Esol class | Moderately |
| Ali log s | -7.21 |
| Ali solubility (mg/ml) | 0.0000258 |
| Ali solubility (mol/l) | 6.19E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -4.77 |
| Silicos-it solubility (mg/ml) | 0.00711 |
| Silicos-it solubility (mol/l) | 0.0000171 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.87 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.56 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 4.09 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.252 |
| Logd | 2.689 |
| Logp | 5.405 |
| F (20%) | 0.973 |
| F (30%) | 0.987 |
| Mdck | 2.44E-05 |
| Ppb | 0.9729 |
| Vdss | 0.341 |
| Fu | 0.0071 |
| Cyp1a2-inh | 0.095 |
| Cyp1a2-sub | 0.234 |
| Cyp2c19-inh | 0.521 |
| Cyp2c19-sub | 0.324 |
| Cl | 2.067 |
| T12 | 0.264 |
| H-ht | 0.959 |
| Dili | 0.759 |
| Roa | 0.893 |
| Fdamdd | 0.735 |
| Skinsen | 0.082 |
| Ec | 0.003 |
| Ei | 0.013 |
| Respiratory | 0.52 |
| Bcf | 0.953 |
| Igc50 | 4.661 |
| Lc50 | 4.065 |
| Lc50dm | 4.365 |
| Nr-ar | 0.05 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.135 |
| Nr-aromatase | 0.934 |
| Nr-er | 0.267 |
| Nr-er-lbd | 0.031 |
| Nr-ppar-gamma | 0.971 |
| Sr-are | 0.294 |
| Sr-atad5 | 0.006 |
| Sr-hse | 0.438 |
| Sr-mmp | 0.493 |
| Sr-p53 | 0.522 |
| Vol | 441.963 |
| Dense | 0.942 |
| Flex | 0.318 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 0 |
| Qed | 0.735 |
| Synth | 2.93 |
| Fsp3 | 0.708 |
| Mce-18 | 68.122 |
| Natural product-likeness | -0.69 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Accepted |