| General Information | |
|---|---|
| ZINC ID | ZINC000084669240 |
| Molecular Weight (Da) | 409 |
| SMILES | CC1(C)Oc2cc(C(=O)c3csc4ccccc34)cc(O)c2[C@@H]2C[C@H](O)CC[C@H]21 |
| Molecular Formula | C24O4S1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 113.011 |
| HBA | 4 |
| HBD | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| LogP | 4.573 |
| Activity (Ki) in nM | 1258.93 |
| Polar Surface Area (PSA) | 95 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | - |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.03566598 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 15 |
| Fraction csp3 | 0.38 |
| Ilogp | 3.31 |
| Xlogp3 | 4.83 |
| Wlogp | 5.25 |
| Mlogp | 3.17 |
| Silicos-it log p | 5.54 |
| Consensus log p | 4.42 |
| Esol log s | -5.67 |
| Esol solubility (mg/ml) | 0.000881 |
| Esol solubility (mol/l) | 0.00000216 |
| Esol class | Moderately |
| Ali log s | -6.56 |
| Ali solubility (mg/ml) | 0.000113 |
| Ali solubility (mol/l) | 0.00000027 |
| Ali class | Poorly sol |
| Silicos-it logsw | -6.32 |
| Silicos-it solubility (mg/ml) | 0.000194 |
| Silicos-it solubility (mol/l) | 0.00000047 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.36 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 4.41 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.525 |
| Logd | 4.267 |
| Logp | 5.574 |
| F (20%) | 0.008 |
| F (30%) | 0.01 |
| Mdck | - |
| Ppb | 100.32% |
| Vdss | 0.657 |
| Fu | 0.71% |
| Cyp1a2-inh | 0.777 |
| Cyp1a2-sub | 0.76 |
| Cyp2c19-inh | 0.874 |
| Cyp2c19-sub | 0.272 |
| Cl | 3.83 |
| T12 | 0.057 |
| H-ht | 0.947 |
| Dili | 0.699 |
| Roa | 0.763 |
| Fdamdd | 0.942 |
| Skinsen | 0.047 |
| Ec | 0.003 |
| Ei | 0.028 |
| Respiratory | 0.773 |
| Bcf | 1.709 |
| Igc50 | 5.234 |
| Lc50 | 6.284 |
| Lc50dm | 6.488 |
| Nr-ar | 0.066 |
| Nr-ar-lbd | 0.04 |
| Nr-ahr | 0.979 |
| Nr-aromatase | 0.899 |
| Nr-er | 0.801 |
| Nr-er-lbd | 0.907 |
| Nr-ppar-gamma | 0.965 |
| Sr-are | 0.889 |
| Sr-atad5 | 0.179 |
| Sr-hse | 0.906 |
| Sr-mmp | 0.987 |
| Sr-p53 | 0.934 |
| Vol | 413.456 |
| Dense | 0.987 |
| Flex | 0.074 |
| Nstereo | 3 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 2 |
| Acute aquatic toxicity | - |
| Toxicophores | 3 |
| Qed | 0.568 |
| Synth | 3.689 |
| Fsp3 | 0.375 |
| Mce-18 | 99.303 |
| Natural product-likeness | 0.951 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |