| General Information | |
|---|---|
| ZINC ID | ZINC000084670449 |
| Molecular Weight (Da) | 469 |
| SMILES | O=C(N[C@H]1CCCOc2c1nn(-c1ccccc1Cl)c2-c1ccc(Cl)cc1)c1ccno1 |
| Molecular Formula | C23H18Cl2N4O3 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 119.446 |
| HBA | 5 |
| HBD | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| LogP | 5.149 |
| Activity (Ki) in nM | 0.2291 |
| Polar Surface Area (PSA) | 82.18 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.939 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 22 |
| Fraction csp3 | 0.17 |
| Ilogp | 3.78 |
| Xlogp3 | 4.89 |
| Wlogp | 5.15 |
| Mlogp | 3.02 |
| Silicos-it log p | 4.26 |
| Consensus log p | 4.22 |
| Esol log s | -6.01 |
| Esol solubility (mg/ml) | 0.000459 |
| Esol solubility (mol/l) | 0.00000097 |
| Esol class | Poorly sol |
| Ali log s | -6.35 |
| Ali solubility (mg/ml) | 0.000209 |
| Ali solubility (mol/l) | 0.00000044 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.51 |
| Silicos-it solubility (mg/ml) | 0.00000145 |
| Silicos-it solubility (mol/l) | 3.10E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.69 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 4.08 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.45 |
| Logd | 4.105 |
| Logp | 4.697 |
| F (20%) | 0.001 |
| F (30%) | 0.086 |
| Mdck | - |
| Ppb | 98.42% |
| Vdss | 0.909 |
| Fu | 1.59% |
| Cyp1a2-inh | 0.667 |
| Cyp1a2-sub | 0.14 |
| Cyp2c19-inh | 0.931 |
| Cyp2c19-sub | 0.078 |
| Cl | 1.547 |
| T12 | 0.052 |
| H-ht | 0.755 |
| Dili | 0.991 |
| Roa | 0.382 |
| Fdamdd | 0.715 |
| Skinsen | 0.036 |
| Ec | 0.003 |
| Ei | 0.008 |
| Respiratory | 0.27 |
| Bcf | 2.069 |
| Igc50 | 4.719 |
| Lc50 | 6.777 |
| Lc50dm | 5.638 |
| Nr-ar | 0.01 |
| Nr-ar-lbd | 0.247 |
| Nr-ahr | 0.957 |
| Nr-aromatase | 0.897 |
| Nr-er | 0.822 |
| Nr-er-lbd | 0.051 |
| Nr-ppar-gamma | 0.926 |
| Sr-are | 0.925 |
| Sr-atad5 | 0.926 |
| Sr-hse | 0.746 |
| Sr-mmp | 0.855 |
| Sr-p53 | 0.937 |
| Vol | 435.361 |
| Dense | 1.075 |
| Flex | 0.172 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | - |
| Toxicophores | 1 |
| Qed | 0.428 |
| Synth | 3.204 |
| Fsp3 | 0.174 |
| Mce-18 | 85.704 |
| Natural product-likeness | -1.418 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |