| General Information | |
|---|---|
| ZINC ID | ZINC000084730469 |
| Molecular Weight (Da) | 433 |
| SMILES | C=CCn1cc(CC(=O)NC2CCCCC2)c2cc(OCc3cccc(OC)c3)ccc21 |
| Molecular Formula | C27N2O3 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 125.664 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| LogP | 5.371 |
| Activity (Ki) in nM | 398.107 |
| Polar Surface Area (PSA) | 52.49 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.15188992 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 15 |
| Fraction csp3 | 0.37 |
| Ilogp | 4.4 |
| Xlogp3 | 5.2 |
| Wlogp | 5.25 |
| Mlogp | 3.29 |
| Silicos-it log p | 5.47 |
| Consensus log p | 4.72 |
| Esol log s | -5.48 |
| Esol solubility (mg/ml) | 1.42E-03 |
| Esol solubility (mol/l) | 3.28E-06 |
| Esol class | Moderately |
| Ali log s | -6.05 |
| Ali solubility (mg/ml) | 3.86E-04 |
| Ali solubility (mol/l) | 8.92E-07 |
| Ali class | Poorly sol |
| Silicos-it logsw | -7.83 |
| Silicos-it solubility (mg/ml) | 6.35E-06 |
| Silicos-it solubility (mol/l) | 1.47E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.25 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 1 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.34 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.715 |
| Logd | 4.226 |
| Logp | 5.367 |
| F (20%) | 0.264 |
| F (30%) | 0.816 |
| Mdck | 2.31E-05 |
| Ppb | 0.9847 |
| Vdss | 1.743 |
| Fu | 0.0161 |
| Cyp1a2-inh | 0.458 |
| Cyp1a2-sub | 0.797 |
| Cyp2c19-inh | 0.905 |
| Cyp2c19-sub | 0.101 |
| Cl | 10.272 |
| T12 | 0.214 |
| H-ht | 0.492 |
| Dili | 0.632 |
| Roa | 0.486 |
| Fdamdd | 0.883 |
| Skinsen | 0.536 |
| Ec | 0.003 |
| Ei | 0.011 |
| Respiratory | 0.447 |
| Bcf | 1.46 |
| Igc50 | 4.843 |
| Lc50 | 6.105 |
| Lc50dm | 5.575 |
| Nr-ar | 0.561 |
| Nr-ar-lbd | 0.006 |
| Nr-ahr | 0.777 |
| Nr-aromatase | 0.08 |
| Nr-er | 0.578 |
| Nr-er-lbd | 0.011 |
| Nr-ppar-gamma | 0.167 |
| Sr-are | 0.691 |
| Sr-atad5 | 0.6 |
| Sr-hse | 0.351 |
| Sr-mmp | 0.441 |
| Sr-p53 | 0.794 |
| Vol | 465.958 |
| Dense | 0.928 |
| Flex | 24 |
| Nstereo | 0.417 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 0 |
| Qed | 3 |
| Synth | 0.46 |
| Fsp3 | 2.382 |
| Mce-18 | 0.37 |
| Natural product-likeness | 48.811 |
| Alarm nmr | -1.195 |
| Bms | 2 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Rejected |