| General Information | |
|---|---|
| ZINC ID | ZINC000084739169 |
| Molecular Weight (Da) | 459 |
| SMILES | CCCCCn1cc(C(=O)C(=O)NC23CC4CC(CC(C4)C2)C3)c2cc(-c3ccco3)ccc21 |
| Molecular Formula | C29N2O3 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 128.337 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| LogP | 5.81 |
| Activity (Ki) in nM | 0.372 |
| Polar Surface Area (PSA) | 64.24 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 1.01269733 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 14 |
| Fraction csp3 | 0.52 |
| Ilogp | 4.33 |
| Xlogp3 | 6.29 |
| Wlogp | 6.36 |
| Mlogp | 3.19 |
| Silicos-it log p | 5.72 |
| Consensus log p | 5.18 |
| Esol log s | -6.36 |
| Esol solubility (mg/ml) | 0.000202 |
| Esol solubility (mol/l) | 0.00000044 |
| Esol class | Poorly sol |
| Ali log s | -7.43 |
| Ali solubility (mg/ml) | 0.0000171 |
| Ali solubility (mol/l) | 3.74E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.08 |
| Silicos-it solubility (mg/ml) | 0.00000385 |
| Silicos-it solubility (mol/l) | 8.39E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.63 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 2 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 1 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 5.85 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.918 |
| Logd | 5.153 |
| Logp | 6.585 |
| F (20%) | 0.062 |
| F (30%) | 0.935 |
| Mdck | 2.62E-05 |
| Ppb | 0.9799 |
| Vdss | 2.797 |
| Fu | 0.0076 |
| Cyp1a2-inh | 0.175 |
| Cyp1a2-sub | 0.142 |
| Cyp2c19-inh | 0.717 |
| Cyp2c19-sub | 0.064 |
| Cl | 3.388 |
| T12 | 0.008 |
| H-ht | 0.462 |
| Dili | 0.458 |
| Roa | 0.911 |
| Fdamdd | 0.827 |
| Skinsen | 0.036 |
| Ec | 0.003 |
| Ei | 0.02 |
| Respiratory | 0.853 |
| Bcf | 1.891 |
| Igc50 | 5.306 |
| Lc50 | 6.356 |
| Lc50dm | 6.802 |
| Nr-ar | 0.001 |
| Nr-ar-lbd | 0.002 |
| Nr-ahr | 0.95 |
| Nr-aromatase | 0.314 |
| Nr-er | 0.519 |
| Nr-er-lbd | 0.003 |
| Nr-ppar-gamma | 0.012 |
| Sr-are | 0.855 |
| Sr-atad5 | 0.172 |
| Sr-hse | 0.904 |
| Sr-mmp | 0.88 |
| Sr-p53 | 0.896 |
| Vol | 486.074 |
| Dense | 0.943 |
| Flex | 0.31 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 6 |
| Qed | 0.243 |
| Synth | 3.883 |
| Fsp3 | 0.517 |
| Mce-18 | 78.545 |
| Natural product-likeness | -0.999 |
| Alarm nmr | 0 |
| Bms | 1 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Rejected |